| İhale No | 2013/123793 |
| Sektör | Matbaa, Yayıncılık Hizmetleri ve Kırtasiye Malzemeleri |
| İdare | Yıldız Teknik Üniversitesi İdari ve Mali İşler Daire Başkanlığı |
| İhale Tipi | Mal Alımı |
| İhale Usulü | Açık İhale |
| İhale İli | İstanbul |
| İşin İli | İstanbul |
| Yayın Tarihi | 30 Ağustos 2015 |
| İhale Tarihi | 3 Ekim 2013 11:00 |
Bu ve benzer
yüzlerce ihale ve doğrudan temine vakit harcamadan, kolayca erişmek için ihale takip
hizmetlerimizden birini satın alabilirsiniz.
Temel
1.500 / 1 yıl
(KDV Hariç...)
(KDV Hariç...)
- Kamu İhaleleri
- E-İhaleler
- İlanlı, İlansız Tüm İhaleler
- Doğrudan Temin İhaleleri
- Sınırsız İhale Takibi
- Sınırsız İhale Alarmı
- Günlük İhale Raporu
Kurumsal
3.000 / 1 yıl
(KDV Hariç...)
(KDV Hariç...)
- Temel Paket Dahil
- AB İhaleleri
- İhale Sonuçları
- Kazanan Firmalar
- İhale Arşivi
- KİK Kararları
- Yasaklı Firma Sorgulama
İDARİ VE MALİ İŞLER DAİRE BAŞKANLIĞI YÜKSEKÖĞRETİM KURUMLARI YILDIZ TEKNİK ÜNİVERSİTESİ
Yabancı Dil Kitap Alımı alımı 4734 sayılı Kamu İhale Kanununun 19 uncu maddesine göre açık ihale usulü ile ihale edilecektir. İhaleye ilişkin ayrıntılı bilgiler aşağıda yer almaktadır:
| İhale Kayıt Numarası | : | 2013/123793 |
| 1-İdarenin | ||
| a) Adresi | : | Yıldız Teknik Üniversitesi Rektörlüğü Merkez Kampüs Yıldız Yokuşu Balmumcu 34349 BEŞİKTAŞ İSTANBUL BEŞİKTAŞ/İSTANBUL |
| b) Telefon ve faks numarası | : | 2123832141 - 2122612921 |
| c) Elektronik Posta Adresi | : | imidb@yildiz.edu.tr |
| ç) İhale dokümanının görülebileceği internet adresi (varsa) | : | https://ekap.kik.gov.tr/EKAP/ |
2-İhale konusu malın
| a) Niteliği, türü ve miktarı | : | İhalenin niteliği, türü ve miktarına ilişkin ayrıntılı bilgiye EKAP’ta (Elektronik Kamu Alımları Platformu) yer alan ihale dokümanı içinde bulunan idari şartnameden ulaşılabilir. |
| b) Teslim yeri | : | Yıldız Teknik Üniversitesi Rektörlüğü Kütüphane ve Dokümantasyon Daire Başkanlığı Davutpaşa ESENLER/İSTANBUL |
| c) Teslim tarihi | : | Sözleşmenin imzalanmasını takip eden 45 gün içerisinde kitaplar koliler içersinde paket listeleri ile birlikte yeni, orjinal ve hiç kullanılmamış olarak imza karşılığı Kütüphane ve Dökümantasyon Daire Başkanlığına teslim edilecektir. Ancak işin 31.12.2013 tarihinde bitirilmesi esastır |
3- İhalenin
| a) Yapılacağı yer | : | Yıldız Teknik Üniversitesi Rektörlüğü Merkez Kampüs Rektörlük Binası İdari ve Mali İşler Daire Başkanlığı Satınalma Müdürlüğü Yıldız Yokuşu Balmumcu 34349 BEŞİKTAŞ/İSTANBUL |
| b) Tarihi ve saati | : | 03.10.2013 - 11:00 |
4. İhaleye katılabilme şartları ve istenilen belgeler ile yeterlik değerlendirmesinde uygulanacak kriterler:
4.1. İhaleye katılma şartları ve istenilen belgeler:
4.1.1. Mevzuatı gereği kayıtlı olduğu Ticaret ve/veya Sanayi Odası ya da ilgili Esnaf ve Sanatkarlar Odası belgesi;
4.1.1.1. Gerçek kişi olması halinde, ilk ilan veya ihale tarihinin içinde bulunduğu yılda alınmış, ilgisine göre Ticaret ve/veya Sanayi Odasına ya da ilgili Esnaf ve Sanatkarlar Odasına kayıtlı olduğunu gösterir belge,
4.1.1.2. Tüzel kişi olması halinde, ilgili mevzuatı gereği kayıtlı bulunduğu Ticaret ve/veya Sanayi Odasından, ilk ilan veya ihale tarihinin içinde bulunduğu yılda alınmış, tüzel kişiliğin odaya kayıtlı olduğunu gösterir belge,
4.1.2. Teklif vermeye yetkili olduğunu gösteren imza beyannamesi veya imza sirküleri;
4.1.2.1. Gerçek kişi olması halinde, noter tasdikli imza beyannamesi,
4.1.2.2. Tüzel kişi olması halinde, ilgisine göre tüzel kişiliğin ortakları, üyeleri veya kurucuları ile tüzel kişiliğin yönetimindeki görevlileri belirten son durumu gösterir Ticaret Sicil Gazetesi, bu bilgilerin tamamının bir Ticaret Sicil Gazetesinde bulunmaması halinde, bu bilgilerin tümünü göstermek üzere ilgili Ticaret Sicil Gazeteleri veya bu hususları gösteren belgeler ile tüzel kişiliğin noter tasdikli imza sirküleri,
4.1.3. Şekli ve içeriği İdari Şartnamede belirlenen teklif mektubu.
4.1.4. Şekli ve içeriği İdari Şartnamede belirlenen geçici teminat.
4.1.5 İhale konusu alımın tamamı veya bir kısmı alt yüklenicilere yaptırılamaz.
| 4.2. Ekonomik ve mali yeterliğe ilişkin belgeler ve bu belgelerin taşıması gereken kriterler: |
| İdare tarafından ekonomik ve mali yeterliğe ilişkin kriter belirtilmemiştir. |
| 4.3. Mesleki ve Teknik yeterliğe ilişkin belgeler ve bu belgelerin taşıması gereken kriterler: |
| İdare tarafından mesleki ve teknik yeterliğe ilişkin kriter belirtilmemiştir. |
5.Ekonomik açıdan en avantajlı teklif sadece fiyat esasına göre belirlenecektir.
6. İhale yerli ve yabancı tüm isteklilere açıktır.
7. İhale dokümanının görülmesi ve satın alınması:
7.1. İhale dokümanı, idarenin adresinde görülebilir ve 50 TRY (Türk Lirası) karşılığı Yıldız Teknik Üniversitesi Rektörlüğü Merkez Kampus Rektörlük Binası İdari ve Mali İşler Daire Başkanlığı Satınalma Müdürlüğü Yıldız Yokuşu Balmumcu 34349 BEŞİKTAŞ/İSTANBUL adresinden satın alınabilir.
7.2. İhaleye teklif verecek olanların ihale dokümanını satın almaları veya EKAP üzerinden e-imza kullanarak indirmeleri zorunludur.
8. Teklifler, ihale tarih ve saatine kadar Yıldız Teknik Üniversitesi Rektörlüğü Merkez Kampus Rektörlük Binası İdari ve Mali İşler Daire Başkanlığı Satınalma Müdürlüğü Yıldız Yokuşu Balmumcu 34349 BEŞİKTAŞ/İSTANBUL adresine elden teslim edilebileceği gibi, aynı adrese iadeli taahhütlü posta vasıtasıyla da gönderilebilir.
9. İstekliler tekliflerini, mal kalem-kalemleri için teklif birim fiyatlar üzerinden vereceklerdir. İhale sonucu, üzerine ihale yapılan istekliyle her bir mal kalemi miktarı ile bu mal kalemleri için teklif edilen birim fiyatların çarpımı sonucu bulunan toplam bedel üzerinden birim fiyat sözleşme imzalanacaktır.
Bu ihalede, kısmı teklif verilebilir.
10. İstekliler teklif ettikleri bedelin %3’ünden az olmamak üzere kendi belirleyecekleri tutarda geçici teminat vereceklerdir.
11. Verilen tekliflerin geçerlilik süresi, ihale tarihinden itibaren 60 (altmış) takvim günüdür.
12. Konsorsiyum olarak ihaleye teklif verilemez.
| Cetvel Adı | Miktar | Birim |
|---|---|---|
| 1000Solved Problems in Modern Physics (9783642043321) | 5 | Adet |
| 101+Great Ideas for Introducing Key Concepts in Mathematics: AResource for Secondary School Teachers (9781412927062) | 1 | Adet |
| 150and more basic NMR experiments: (9783527295128) | 1 | Adet |
| 2011Revision - Manual for Railway Engineering - AREMA | 1 | Adet |
| 3DEngine Design for Virtual Globes | 1 | Adet |
| ACooperative Species: Human Reciprocity and Its Evolution(9780691151250) | 1 | Adet |
| AHistory of Architectural Conservation (9780750655118) | 1 | Adet |
| AJourney in Mathematics Education Research (9789048197286) | 1 | Adet |
| ANew Japan for the Twenty-First Century: An Inside Overview ofCurrent Fundamental Changes and Problems (9780415541824) | 1 | Adet |
| APython Primer for ArcGIS (9781466274594) | 2 | Adet |
| ASecular Age (9780674026766) | 1 | Adet |
| AShort Course in Soil-Structure Engineering of Deep Foundations,Excavations and Tunnels (9780727732637) | 1 | Adet |
| AboutTeaching Mathematics: A K-8 Resource, 3rd Edition (9780941355766) | 1 | Adet |
| AcademicWriting for Graduate Students: Essential Tasks and Skills(9780472035069) | 1 | Adet |
| Adam`sFallacy: A Guide to Economic Theology (9780674027299) | 1 | Adet |
| AdaptiveControl Design and Analysis (Online versiyonu da satınalınabilir.) (9780471274520) | 1 | Adet |
| AdaptiveControl of Systems with Actuator and Sensor Nonlinearities(9780471156543) | 1 | Adet |
| AdaptiveControl of Systems with Actuator Failures (9781852337889) | 1 | Adet |
| AdaptiveControl Tutorial (9780898716153) | 1 | Adet |
| AdaptiveControl: Stability, Convergence and Robustness (9780486482026) | 1 | Adet |
| AdvancedPID Control (9781556179426) | 1 | Adet |
| AdvancedTrain Control Systems (9781845644949) | 1 | Adet |
| Advancesin Performance-Based Earthquake Engineering (9789048187454) | 1 | Adet |
| Advancesin Spatial Data Handling: Geospatial Dynamics, Geosimulation andExploratory Visualization Series: Advances in GeographicInformation Science (9783642342028) | 1 | Adet |
| Agent-Basedand Individual-Based Modeling: A Practical Introduction(9780691136745) | 1 | Adet |
| AircraftDesign : A conceptual Approach (9781600869112) | 1 | Adet |
| AirportGeomatics | 1 | Adet |
| Aktien-und GmbH-Konzernrecht (9783406599057) | 1 | Adet |
| Amsterdam(9780674009936) | 1 | Adet |
| AnIntroduction to Atomic-, Molecular and Quantum-Physics(9783642102974) | 5 | Adet |
| -AnIntroduction to Error Analysis: The Study of Uncertainties inPhysical Measurements (9780935702750) | 2 | Adet |
| AnIntroduction to Geotechnical Engineering (9780132496346) | 1 | Adet |
| AnIntroduction to MultiAgent Systems (9780470519462) | 1 | Adet |
| AnIntroduction to Political Philosophy (9780521836258) | 1 | Adet |
| AnIntroduction to Underwater Acoustics (9783540784807) | 2 | Adet |
| Anİdeal Husband (9780486414232) | 5 | Adet |
| Anintroduction to the optical spectroscopy of inorganic solids(9780470868867) | 2 | Adet |
| Analogiesat War: Korea, Munich, Dien Bien Phu, and the Vietnam Decisions of1965 (9780691025353) | 1 | Adet |
| Analysisand Design of Retaining Structures against Earthquakes(9780784402061) | 1 | Adet |
| Analysis,Design, Construction, and Testing of Deep Foundations (GSP88)(9780784404225) | 1 | Adet |
| AnalyzingLand Readjustment: Economics, Law, and Collective Action(9781558441644) | 1 | Adet |
| AnalyzingQualitative Data: Systematic Approaches (9780761924906) | 1 | Adet |
| Angesau Quotidien Tome 2 (9782894362402) | 1 | Adet |
| AnsysWorkbench 14.0: A Tutorial Approach (9781932709964) | 2 | Adet |
| AppliedAlgebra and Functional Analysis (9780486675985) | 1 | Adet |
| AppliedCombinatorics (9781420099829) | 1 | Adet |
| AppliedCombinatorics, 6th Edition (9780470458389) | 1 | Adet |
| AppliedRegression Analysis (9780471170822) | 2 | Adet |
| AppliedStatistics for Civil and Environmental Engineers (9781405179171) | 1 | Adet |
| AppliedSystem Identification (9780130792112) | 1 | Adet |
| ApplyingProblem Solving Strategies 3-4 (Math Power Practice)(9781591984009) | 1 | Adet |
| ArcWelding (9781605251899) | 4 | Adet |
| Archaeologyand Heritage (9780826458957) | 1 | Adet |
| ArchitecturalColour in the Professional Palette (9780415597081) | 1 | Adet |
| Architecturalconservation in Europe and the Americas : national experiences andpractice (9780470603857) | 1 | Adet |
| Artof Foundation Engineering Practice (9780784410936) | 1 | Adet |
| AssessingIrregular Warfare: A Framework for Intelligence Analysis(9780833043221) | 1 | Adet |
| AssessingMathematical Proficiency (Mathematical Sciences Research InstitutePublications) (9780521874922) | 1 | Adet |
| Assimilationand Empire (9780199579167) | 1 | Adet |
| Atomicand Electronic Structure of Solids (9780521523394) | 1 | Adet |
| Atoms,Radiation, and Radiation Protection (Physics Textbook) [Paperback] (9783527406067) | 2 | Adet |
| AugustinsFrage "Was ist denn Zeit?" (9783826028229) | 1 | Adet |
| -BasicHealth Physics [Hardcover] (9783527408238) | 2 | Adet |
| BasicTransport Phenomena in Biomedical Engineering, Third Edition(9781439826706) | 1 | Adet |
| Basicsof Laser Physics (9783642235641) | 5 | Adet |
| BaslerKommentar, Obligationenrecht I-II (9783719029661) | 1 | Adet |
| BaslerKommentar, Revisionsrecht (9783719025878) | 1 | Adet |
| BatteryManagement Systems for Large Lithium Ion Battery Packs(9781608071043) | 1 | Adet |
| BatteryManagement Systems: Design by Modelling (9789048161089) | 1 | Adet |
| Becominga Successful Teacher of Mathematics (9780415230698) | 1 | Adet |
| BehavioralFinance and Investor Types: Managing Behavior to Make BetterInvestment Decisions (9781118011508) | 1 | Adet |
| BehavioralMacroeconomics (9781781002582) | 1 | Adet |
| Beinga Historian: An Introduction to the Professional World of History (9781107021594) | 1 | Adet |
| BestPractices for Teaching Mathematics: What Award-Winning ClassroomTeachers Do (Best Practices Series) (9781412924559) | 1 | Adet |
| Beyondthe Turnstile: Making the Case for Museums and Sustainable Values (9780759112216) | 1 | Adet |
| BiomedicalOptical Imaging (9780195150445) | 1 | Adet |
| BiomedicalPhotonics Handbook (9780849311161) | 1 | Adet |
| BiotechnologyFundamentals (9781439820094) | 1 | Adet |
| BlueprintReading Basics (9780831131258) | 4 | Adet |
| Body,Space, Expression: The Development of Rudolf Laban`s Movement andDance Concepts (9783110107807) | 1 | Adet |
| BoschAutomotive Handbook, 8th Edition (9780768048513) | 1 | Adet |
| Bourdieuin International Relations: Rethinking Key Concepts in IR(9780415528528) | 1 | Adet |
| BuildYour Own Small Wind Power System (9780071761574) | 1 | Adet |
| BuildingResilient Student (9780761945444) | 2 | Adet |
| BusinessStrategy and Sustainability: 3 (Developments in CorporateGovernance and Responsibility) (9781780527369) | 1 | Adet |
| CanDo Problem Solving Year 1 Teacher`s Book: Teacher`s Book Year(9780748786596) | 1 | Adet |
| Carnageand Culture (9780385720380) | 1 | Adet |
| Celebration,Entertainment and Theater in the Ottoman World (9780857420442) | 1 | Adet |
| ChamberSymphony No. 1 for 15 Solo Instruments, Op. 9 (9780486419008) | 1 | Adet |
| ChemistryOf Natural Products (9788180520891) | 1 | Adet |
| Childhood(Key Ideas) (9780415119801) | 1 | Adet |
| Childhoodand Children`s Culture (9788778383761) | 1 | Adet |
| Childhoodpoverty and social exclusion: From a child`s perspective (Studiesin Poverty, Inequality, and Social Exclusion)(9781861343628) | 1 | Adet |
| Childrenand Childhood in Western Society Since 1500 (9780582784536) | 1 | Adet |
| Childrenin Culture, Revisited: Further Approaches to Childhood(9780230275546) | 1 | Adet |
| Children,Young People and Social Inclusion: Participation for What?(9781861346629) | 1 | Adet |
| Children`smathematics: cognitively guided instruction (9780325001371) | 1 | Adet |
| Chinaand the Middle East (9781857436310) | 1 | Adet |
| China`sSoft Power and International Relations (9780415604017) | 1 | Adet |
| ChineseForeign Policy: An Introduction (9780415528870) | 1 | Adet |
| ChoreographingDifference: Body and Identity in Contemporary Dance (9780819563217) | 1 | Adet |
| ChoreographingEmpathy: Kinesthesia in Performance (9780415596558) | 1 | Adet |
| ChoreographingRelations: Practical Philosophy and Contemporary Choreography inthe Works of Antonia Baehr, Gilles Deleuze, Juan Dominguez, FélixGuat (9783940388209) | 1 | Adet |
| ClassicalMechanics (9781860944246) | 1 | Adet |
| Cleansolvents:alternative media for chemical reactions andprocessing (9780841237797) | 1 | Adet |
| Cognitiveand Linguistic Aspects of Geographic Space: New Perspectives onGeographic Information Research Series: Lecture Notes inGeoinformation and (9783642343582) | 1 | Adet |
| CognitiveScience and Mathematics Education (9780805800579) | 1 | Adet |
| Colorcommunication in architectural space (9783764375966) | 1 | Adet |
| ColorInfluencing Form: A Color Course Book (9781581125429) | 1 | Adet |
| ColorSpace and Its Division: Color Order from Antiquity to the Present (9780471326700) | 1 | Adet |
| Color,Environment & Human Response (9780471286677) | 1 | Adet |
| Combustion(9781894078559) | 1 | Adet |
| CommunityPolicing and Problem Solving: Strategies and PracticesCommunityPolicing and Problem Solving: Strategies and Practices(9780135120866) | 1 | Adet |
| CompletePiano Concertos in Full Score (9780486245638) | 2 | Adet |
| CompletePiano Solo Works - Urtext edition (9790006204359) | 1 | Adet |
| CompleteWorks for Organ Volume 1 (9790006520626) | 1 | Adet |
| CompleteWorks for Organ Volume 2 (9790006525126) | 1 | Adet |
| ComplexProblem Solving: The European Perspective (9780805817836) | 1 | Adet |
| CompositeMaterials and Joining Technologies for Composites, Volume 7:Proceedings of the 2012 Annual Conference on Experimental andApplied Mechanics (9781461445524) | 2 | Adet |
| ComprehensiveNatural Products II: Chemistry and Biology (9780080453811) | 1 | Adet |
| COMPUTATIONALPHYSICS (9780521833462) | 1 | Adet |
| ComputationalWelding Mechanics (9781441935991) | 1 | Adet |
| Concrete(9780130646323) | 1 | Adet |
| Conservationof the 20th Century Architectural-Icomos (9758599704) | 1 | Adet |
| Constraint-basedscheduling: applying constraint programming to scheduling(9780792374084) | 1 | Adet |
| Constructingand Reconstructing Childhood: Contemporary Issues in theSociological Study of Childhood (9780750705967) | 1 | Adet |
| Constructionand Geotechnical Methods in Foundation Engineering (9780070352452) | 1 | Adet |
| ConstructionControl for Earth and Rockfill Dams (9780784403327) | 1 | Adet |
| ContactLines for Electrical Railways: Planning - Design - Implementation- Maintenance (9783895783227) | 1 | Adet |
| ContemporaryChoreography (9780415490870) | 1 | Adet |
| ContemporaryMilitary Theory: The Dynamics of War (9780415643047) | 1 | Adet |
| contemporaryphilosophical and psychological perspektives on moral developmentand education (9781572737228) | 4 | Adet |
| ContemporaryTheory of Conservation (9780750662246) | 1 | Adet |
| ContemporaryTopics in Deep Foundations (GSP185) (9780784410219) | 1 | Adet |
| ContemporaryTopics in Ground Modification, Problem Soils, and Geo-Support(GSP187) (9780784410233) | 1 | Adet |
| ContemporaryTopics in In Situ Testing, Analysis, and Reliability ofFoundations (GSP186) (9780784410226) | 1 | Adet |
| ContentAnalysis: An Introduction to Its Methodology (9780761915454) | 1 | Adet |
| CooperativeControl and Optimization (Applied Optimization) (9781441952172) | 1 | Adet |
| CorporateWarriors: The Rise of the Privatized Military Industry(9780801474361) | 1 | Adet |
| CosmopoliticalClaims:Turkish-German literatures from Nadolny to Pamuk(9781587295843) | 2 | Adet |
| CounterinsurgencyLaw: New Directions in Asymmetric Warfare (9780199941445) | 1 | Adet |
| CounterinsurgencyWarfare: Theory and Practice (9780275993030) | 1 | Adet |
| CreatingMilitary Power: The Sources of Military Effectiveness(9780804753999) | 1 | Adet |
| CreativeMathematics (9780415164627) | 1 | Adet |
| CreativeTeaching: Getting it Right (Continuum Practical Teaching Guides)(9780826491589) | 1 | Adet |
| CriticalGeographies of Childhood and Youth: Contemporary Policy andPractice (9781847428455) | 1 | Adet |
| CriticalIssues In Mathematics Education (9781607520399) | 1 | Adet |
| Cross-CurricularTeaching and Learning in the Secondary School... Mathematics(9780415572033) | 1 | Adet |
| Crossingthe River with Dogs: Problem Solving for College Students (9781931914147) | 1 | Adet |
| CrowdsourcingGeographic Knowledge: Volunteered Geographic Information (VGI) inTheory and Practice (9789400745865) | 1 | Adet |
| Crystalsand crystal structure (9780470018217) | 3 | Adet |
| Culturesof War: Pearl Harbor / Hiroshima / 9-11 / Iraq (9780393340686) | 1 | Adet |
| Dance(9780262517775) | 1 | Adet |
| Dance[and] Theory (9783837621518) | 1 | Adet |
| Danceanalysis: theory and practice (9781852730031) | 1 | Adet |
| DanceImagery for Technique and Performance (9780873229432) | 1 | Adet |
| Dancefilm:Choreographyand the Moving Image: Choreography and the Moving Image(9780195367232) | 1 | Adet |
| DangerousTimes?: The International Politics of Great Power Peace(9781589017108) | 1 | Adet |
| DasRecht der Freiheit (9783518585627) | 1 | Adet |
| DasSystem zur Durchsetzung von Aktionärsrechten (9783725563265) | 1 | Adet |
| DecisionMaking and Problem Solving Strategies: 66 (Creating Success)(9780749455514) | 1 | Adet |
| Deepand Underground Excavations (GSP206) (9780784411070) | 1 | Adet |
| DeepFoundations and Geotechnical In Situ Testing (GSP205)(9780784411063) | 1 | Adet |
| DeformationAnalysis in Soft Ground Improvement (Geotechnical, Geological andEarthquake Engineering) (9789400717206) | 1 | Adet |
| DeGarmo`sMaterials and Processes in Manufacturing (9780470924679) | 3 | Adet |
| Democraciesat War (9780691089492) | 1 | Adet |
| DerAnfang der Philosophie (9783150094952) | 1 | Adet |
| DerVerwaltungsrat (9783725554379) | 1 | Adet |
| Designand Construction of Tunnels: Analysis of Controlled Deformationsin Rock and Soils (9783540738749) | 1 | Adet |
| DesignApplications of Raft Foundations (9780727727657) | 1 | Adet |
| Designof Agent-Based Models (9788090466111) | 1 | Adet |
| Designof Foundation Systems: Principles and Practices, Third Edition (9781842651278) | 1 | Adet |
| DeterministicOperations Research: Models and Methods in Linear Optimization(9780470484517) | 1 | Adet |
| Developmentand Design of Heritage Sensitive Sites (9780415486439) | 1 | Adet |
| Developmentof Gifted and Talented Mathematics Students and the NationalCouncil of Teachers of Mathematics Standards (9780788143328) | 1 | Adet |
| Developmentsin Corporate Governance and Responsibility (9780857242952) | 1 | Adet |
| DeviceApplications of Silicon Nanocrystals and Nanostructures(9780387786889) | 1 | Adet |
| Dialogueand Learning in Mathematics Education: Intention, Reflection,Critique (Mathematics Education Library) (9781402019272) | 1 | Adet |
| DieGeschichtsphilosophie Hegels und der Hegelianer bis auf Marx undHartmann (9783846007501) | 1 | Adet |
| Diffraction,Fourier Optics and Imaging (9780471238164) | 1 | Adet |
| Diffusionand Mass Transfer (9781466515680) | 1 | Adet |
| DigitalMapping (9780632064915) | 1 | Adet |
| DigitalSignal Processing, A computer-based approach / 4th Edition | 2 | Adet |
| Dilemmasand Connections: Selected Essays (9780674055322) | 1 | Adet |
| DiscreteMathematics: Proofs, Structures and Applications (9781439812808) | 1 | Adet |
| Distributedand Cloud Computing: From Parallel Processing to the Internet ofThings (9780123858801) | 1 | Adet |
| doingdemocracy (9780820497457) | 4 | Adet |
| Dracula(9780486411095) | 5 | Adet |
| EarthReinforcement and Soil Structures (9780727734891) | 1 | Adet |
| Earthquakesand Health Monitoring of Civil Engineering (9789400751811) | 1 | Adet |
| Economicand Business Analyses-Quantitative Methods Using Spreadsheets(9789812834928) | 1 | Adet |
| EconomicDynamics (9783642135033) | 1 | Adet |
| EconomicImpacts Of Intelligent Transportation Systems: Innovations andCase Studies (9780762309788) | 1 | Adet |
| Economics:Theory and Practice (9781118233597) | 2 | Adet |
| EducationalIssues in Geotechnical Engineering (GSP109) (9780784405222) | 1 | Adet |
| EducationalResiliency: Student, Teacher, and School Perspectives(9781931576086) | 2 | Adet |
| Elementaryand Middle School Mathematics: Texas Edition (9780137025084) | 1 | Adet |
| EmergingBodies: The Performance of Worldmaking in Dance and Choreography(9783837615968) | 1 | Adet |
| Empireand Power in the Reign of Süleyman: Narrating theSixteenth-Century Ottoman World (9781107034426) | 1 | Adet |
| Encyclopediaof Operations Research and Management Science (9780792378273) | 1 | Adet |
| EngineeringApproaches to Mechanical and Robotic Design for Minimally InvasiveSurgeries (9780792377924) | 1 | Adet |
| EngineeringDesign: A Systematic Approach (9781846283185) | 1 | Adet |
| EnglishLanguage Learning Materials: A Critical Review (9781441122308) | 1 | Adet |
| Equalityof Opportunity (9780674004221) | 1 | Adet |
| Equalityof Opportunity: The Economics of Responsibility (9789814368872) | 1 | Adet |
| EssentialMathcad Prime: A guide for Mathcad first-timers and new Primeusers (9780124104105) | 1 | Adet |
| EssentialSoftware Architecture (9783642191756) | 1 | Adet |
| Essentialsof International Relations (Fifth Edition) (The Norton Series inWorld Politics) (9780393935295) | 1 | Adet |
| EthicalForeign Policy?US Humanitarian Interventions (9781409425489) | 1 | Adet |
| EthicalResearch with Children (9780335216505) | 1 | Adet |
| Eurasia`sAscent in Energy and Geopolitics: Rivalry or Partnership forChina, Russia, and Central Asia? (9780415681506) | 1 | Adet |
| Evaluationof Geopier Rammed Aggregate Piers (9780784409558) | 1 | Adet |
| Experimentaland Applied Modeling of Unsaturated Soils (GSP202) (9780784411032) | 1 | Adet |
| FailureCase Studies in Civil Engineering (9780784412558) | 1 | Adet |
| Fairness,Responsibility, and Welfare (9780199653591) | 1 | Adet |
| Feedbackin Second Language Writing Paperback ((-13: 9780521672580 | -10:0521672589)) (9780521672580) | 1 | Adet |
| Feminismand History of Philosophy (9780199243747) | 1 | Adet |
| Feminismis for Everybody (9780896086289) | 1 | Adet |
| FeministContentions (9780415910866) | 1 | Adet |
| Fightingfor a Living (9789089644527) | 1 | Adet |
| FiniteElement Simulation with ANSYS Workbench 14 Theory, Applications,Case Studies (9781585037254) | 2 | Adet |
| FiveOrchestral Pieces and Pelleas und Melisande in Full Score(9780486281209) | 1 | Adet |
| FlexibleFlat Panel Displays (9780470870488) | 1 | Adet |
| FocusGroup Methodology: Principle and Practice - (9781847879097) | 1 | Adet |
| ForeignPolicy Decision Making I (9781258338282) | 1 | Adet |
| ForensicEngineering: From failure to understanding (9780727736130) | 1 | Adet |
| FormalizedMusic: Thought and Mathematics in Composition (9781576470794) | 1 | Adet |
| ForrestGump (9780743453257) | 5 | Adet |
| FoundationDesign and Construction (9780130311801) | 1 | Adet |
| FoundationEngineering Handbook (9780412988912) | 1 | Adet |
| FoundationEngineering in the Face of Uncertainty (GSP229) (9780784412763) | 1 | Adet |
| FoundationVibration Analysis Using Simple Physical Models (9780130107114) | 1 | Adet |
| FoundationVibration Analysis: A Strength of Materials Approach(9780750661645) | 1 | Adet |
| Foundationsfor the future in mathematics education (9780805860573) | 1 | Adet |
| Foundationsin Problem Soils: A Guide to Lightly Loaded FoundationConstruction for Challenging Soil and Site Conditions (9780133189087) | 1 | Adet |
| Foundationsof Multidimensional and Metric Data Structures (9780123694461) | 1 | Adet |
| Foundationson Rock: Engineering Practice (9780419232100) | 1 | Adet |
| FourierTransforms in Spectroscopy (9783527402892) | 1 | Adet |
| Fractals,Graphics, and Mathematics Education (Mathematical Association ofAmerica Notes) (9780883851692) | 1 | Adet |
| Frakestein(9780486282114) | 5 | Adet |
| FromMercenaries to Market: The Rise and Regulation of Private MilitaryCompanies (9780199563890) | 1 | Adet |
| FuelCell Projects for the Evil Genius (9780071496599) | 1 | Adet |
| Full-ScaleTesting and Foundation Design (GSP227) (9780784412084) | 1 | Adet |
| FunctionalGroup Chemistry (9780854046270) | 1 | Adet |
| FundManagement: An Emotional Finance Perspective (9781934667491) | 1 | Adet |
| Fundamentalsof Applied Dynamics (9780471109372) | 1 | Adet |
| Fundamentalsof engineering economic (9780273772910) | 1 | Adet |
| Fundamentalsof evaluation and diagnostics of welded structures (9780857095312) | 2 | Adet |
| Fundamentalsof friction stir spot welding (9781243746245) | 3 | Adet |
| Fundamentalsof Intelligent Transportation Systems Planning (9781580531603) | 1 | Adet |
| Fundamentalsof Kalman Filtering: A Practical Approach (9781600867187) | 1 | Adet |
| Fundamentalsof Modern Manufacturing: Materials, Processes, and Systems(9780470467008) | 1 | Adet |
| Fundamentalsof Nuclear Science and Engineering Second Edition [Hardcover] (9781420051353) | 2 | Adet |
| Fundamentalsof Photonics I (9780819471284) | 2 | Adet |
| Fundamentalsof Risk Management: Understanding, Evaluating and ImplementingEffective Risk Management (9780749465391) | 1 | Adet |
| Fundamentalsof Road Design (9781845640972) | 2 | Adet |
| Fundamentalsof Ship Acoustics: Acoustical Phenomena In and Around Ship Hulls (9780939773695) | 1 | Adet |
| Fundamentalsof Solid State Engineering (9780387921679) | 1 | Adet |
| Fundamentalsof Transportation Engineering: A Multimodal Systems Approach(9780130351241) | 1 | Adet |
| Fundamentalsof Transportation Systems Analysis: Basic Concepts (ISBN-10:0262632896 (9780262632898) | 1 | Adet |
| Fundementalsof Photonics II (9780471358329) | 3 | Adet |
| FusionBonding of Polymer Composites (9781852334291) | 1 | Adet |
| FuzzyMulticriteria Decision-Making: Models, Methods and Applications(9780470682258) | 1 | Adet |
| Games,Strategies and Decision Making (9780716766308) | 2 | Adet |
| GeneralCompetitive Analysis (9780444854971) | 1 | Adet |
| GeoChallenges(GPP7) (9780784412633) | 1 | Adet |
| Geocomputation,Second Edition (9781466503281) | 1 | Adet |
| GeoenvironmentalEngineering and Geotechnics (GSP204) (9780784411056) | 1 | Adet |
| GeographicalInformation Systems and Spatial Optimization (9781466577473) | 1 | Adet |
| Geomechanicsof Failures - Advanced Topics (9789048135370) | 1 | Adet |
| GeospatialData Harmonisation: Methods, Tools and Benefits (9780415691260 ) | 1 | Adet |
| GeospatialTechnology: Basic Concepts and Skills in GPS, GIS and RemoteSensing (9781118483541) | 1 | Adet |
| GeospatialVisualisation Series: Lecture Notes in Geoinformation andCartography Subseries: Publications of the InternationalCartographic Association (9783642122880) | 1 | Adet |
| GeotechnicalCentrifuge Technology (9780751400328) | 1 | Adet |
| GeotechnicalEarthquake Engineering and Soil Dynamics IV (GSP181)(9780784409756) | 1 | Adet |
| GeotechnicalEngineering State of the Art and Practice (GSP226) (9780784412138) | 1 | Adet |
| GeotechnicalEngineering: A Practical Problem Solving Approach (9781604270167) | 1 | Adet |
| GeotechnicalProblem Solving (9781119992974) | 1 | Adet |
| GeotechnicalTesting, Observation, and Documentation (9780784409497) | 1 | Adet |
| GISBased Chemical Fate Modeling: Principles and Applications(9781118059975) | 1 | Adet |
| GISFundamentals: A First Text on Geographic Information Systems,Fourth Edition | 1 | Adet |
| GiantResonances: Fundamental High-Frequency Modes of Nuclear Excitation(Oxford Studies in Nuclear Physics) (9780198517337) | 1 | Adet |
| GiantResonances: Nuclear Structure at Finite Temperature (ContemporaryConcepts in Physics) (9789057025716) | 1 | Adet |
| Governanceand Social Responsibility: International Perspectives (9780230243514) | 1 | Adet |
| Governancein the Business Environment (9780857248787) | 1 | Adet |
| GraphTheory (9789814271127) | 1 | Adet |
| Graphs& Digraphs (9781439826270) | 1 | Adet |
| Graphs,Algorithms, and Optimization, 1e (9781584883968) | 1 | Adet |
| Greenand Ecological Technologies for Urban Planning: Creating SmartCities 9781613504536 (9781613504536) | 1 | Adet |
| GroundAnchors and Anchored Structures (9780471525202) | 1 | Adet |
| GroundImprovement and Geosynthetics (GSP207) (9780784411087) | 1 | Adet |
| GroundImprovement Geosystems: Densification and Reinforcement (9780727726056) | 1 | Adet |
| Groutingand Deep Mixing 2012 (GSP228) (9780784412350) | 1 | Adet |
| Growthand Distribution (9780674364202) | 1 | Adet |
| Guidelinesof Engineering Practice for Braced and Tied Back Excavations(GSP74) (9780784402931) | 1 | Adet |
| Handbookof Adhesives and Sealants (9780071479165) | 2 | Adet |
| Handbookof International Research in Mathematics Education (9780805858754) | 1 | Adet |
| Handbookof Natural Products - Phytochemistry, Botany, Metabolism: I -Alkaloids II - Phenolics III - Terpenes (9783642221453) | 1 | Adet |
| Handbookof Plastics Joining, Second Edition: A Practical Guide(9780815515814) | 3 | Adet |
| Handbookof Real-World Applications of Modeling and Simulation(9781118117774) | 1 | Adet |
| Handkommentarzum Schweizer Privatrecht (9783725563821) | 1 | Adet |
| Happiness,Ethics and Economics (9780415584043) | 1 | Adet |
| Healingthe Nation: Prisoners of War, Medicine, and Nationalism in Turkey,1914--1939 (9780748665785) | 1 | Adet |
| Hearingthe Voices of Children: Social Policy for a New Century(9780415276429) | 1 | Adet |
| HelpingChildren Learn Mathematics (9781118001806) | 1 | Adet |
| HistoryOf Education in Europe (9780846411635) | 1 | Adet |
| Howthe Brain Learns Mathematics (9781412953061) | 1 | Adet |
| Howto Teach Mathematics (9780821813980) | 1 | Adet |
| Howto Tune and Modify Engine Management Systems (9780760315828) | 1 | Adet |
| HowWe Think: A Theory of Goal-Oriented Decision-Making and ItsEducational Applications (Studies in Mathematical Thinking andLearning Series) (9780415878647) | 1 | Adet |
| Humanismusund Kulturkritik (9783770553679) | 1 | Adet |
| HumanitarianIntervention (9780745659817) | 1 | Adet |
| HybridAdhesive Joints (Advanced Structured Materials) (9783642166228) | 1 | Adet |
| Hybridlaser-arc welding (9781845693701) | 1 | Adet |
| HybridWarfare: Fighting Complex Opponents from the Ancient World to thePresent (9781107026087) | 1 | Adet |
| IWant to Be Ready: Improvised Dance As a Practice of Freedom(9780472050840) | 1 | Adet |
| ImpedanceSpectroscopy Theory, Experiment, and Applications Applications(9780471647492) | 1 | Adet |
| IMPERIALGERMAN ARMY 1914-18: Organisation, Structure, Orders of Battle(9781874622291) | 1 | Adet |
| ImprovingMathematics Education: Resources for Decision Making(9780309083003) | 1 | Adet |
| Informationand Self-Organization and Self-Organization Introduction andSelf-Organization (9783540330219) | 1 | Adet |
| Informationder Aktionäre nach Schweizerischem Aktien- und Kapitalmarktrecht(9783725551897) | 1 | Adet |
| InformationRetrieval: Algorithms and Heuristics (9781402030048) | 1 | Adet |
| InformationRetrieval: Implementing and Evaluating Search Engines(9780137035151) | 1 | Adet |
| InnovationManagement: Strategies, Concepts and Tools for Growth and Profit(9788132107224) | 1 | Adet |
| InnovationManagement: Strategies, Implementation, and Profits(9780195142303) | 1 | Adet |
| InnovationPolicy: A Guide for Developing Countries (9780821382691) | 1 | Adet |
| Innovationto the Core: A Blueprint for Transforming the Way Your CompanyInnovates (9781422102510) | 1 | Adet |
| Innovationsin Science and Mathematics Education: Advance Designs forTechnologies of Learning (9780805828467) | 1 | Adet |
| InnovativeSoftware Development in GIS (9781848213647) | 1 | Adet |
| Insightsinto Teaching Mathematics (Continuum Studies in MathematicsEducation) (9780826477484) | 1 | Adet |
| InstitutionalBalancing in the Asia Pacific: Economic interdependence andChina`s rise (9780415541473) | 1 | Adet |
| IntegratedOptics (9780387897745) | 1 | Adet |
| IntegratingCognitive And Rational Theories Of Foreign Policy Decision Making(9780312294090) | 1 | Adet |
| IntelligentRoad Design (9781845640033) | 2 | Adet |
| IntelligentTransportation Systems: Planning, Operations, and Evaluation(9780849331206) | 1 | Adet |
| InteractionDesign for Complex Problem Solving: Developing Useful and UsableSoftware (9781558608313) | 1 | Adet |
| Interactionof Color: Revised and Expandede Edition (9780300115956) | 1 | Adet |
| InteractiveMap Design: Cartography for the Web and Mobile Devices(9781439876220) | 1 | Adet |
| InternationalCorporate Finance (9780073530666) | 1 | Adet |
| InternationalFinance (9780415774598) | 1 | Adet |
| InternationalFinancial Management (9780132842983) | 1 | Adet |
| InternationalHandbook of Giftedness and Talent (9780080437965) | 1 | Adet |
| InternationalPerspectives on Gender and Mathematics Education (InternationalPerspectives on Mathematics Education - Cognition, Equity &Society) (9781617350412) | 1 | Adet |
| InternationalRelations and the First Great Debate (9780415668958) | 1 | Adet |
| InternationalRelations Theory and Philosophy: Interpretive dialogues(9780415462266) | 1 | Adet |
| InternationalTrade and Global Macropolicy (9781461416340) | 1 | Adet |
| IntranationalMacroeconomics (9781107403796) | 1 | Adet |
| Introductionto Finite Element Analysis Using SolidWorks Simulation 2013(9781585037728) | 1 | Adet |
| Introductionto Flavonoids (9789057023538) | 1 | Adet |
| Introductionto Fluorescence Sensing (9781402090028) | 2 | Adet |
| Introductionto Geographic Information Systems with Data Set CD-ROM [Hardcover](9780077805401) | 1 | Adet |
| Introductionto Health Physics: Fourth Edition [Paperback] (9780071423083) | 2 | Adet |
| Introductionto Helicopter and Tiltrotor Flight Simulation (9781563478734) | 1 | Adet |
| Introductionto Hybrid Vehicle System Modeling & Control (9781118308400) | 1 | Adet |
| Introductionto Instrumentation in Life Sciences (9781466512405) | 1 | Adet |
| Introductionto Lens Design (9780943396750) | 1 | Adet |
| Introductionto Natural Products Chemistry (9781439860762) | 1 | Adet |
| Introductionto Nonlinear Optics (9780521877015) | 1 | Adet |
| Introductionto Optical Quantum Information Processing (9780521519144) | 1 | Adet |
| Introductionto Precision Machine Design and Error Assessment (9780849378867) | 1 | Adet |
| Introductionto Rock Mechanics (9780471812005) | 1 | Adet |
| Introductionto the Physics of Cohesive Sediment Dynamics in the MarineEnvironment (9780444515537) | 1 | Adet |
| Introduction_to_Optical_Waveguide_Analysis(9780471406341) | 1 | Adet |
| InvestigatingMathematics with Young Children (9780807733493) | 1 | Adet |
| Investigationsinto Assessment in Mathematics Education: An ICMI Study (9780792320951) | 1 | Adet |
| InvestmentAnalysis and Portfolio Management (9780538482486) | 1 | Adet |
| InvisibleArmies: An Epic History of Guerrilla Warfare from Ancient Times tothe Present (9780871404244) | 1 | Adet |
| InvisibleConnections: Dance, Choreography and Internet Communities(9780415576321) | 1 | Adet |
| Ionicliquids:industrial applications for green chemistry(9780841237896) | 1 | Adet |
| IRand Raman Spectroscopy (9783527302451) | 1 | Adet |
| Iran`sNuclear Programme: Strategic Implications (9780415688567) | 1 | Adet |
| Iraqin Wartime: Soldiering, Martyrdom, and Remembrance (9780521884617) | 1 | Adet |
| IsBehavioral Economics Doomed? The Ordinary versus the Extraordinary(9781906924928) | 1 | Adet |
| İnTheir Time; A History of Feminism in Western Society(9780415930987) | 1 | Adet |
| Jaban`sBuble, Deflation and Long Term Stagnation (9780262014892) | 1 | Adet |
| Japan,Australia and Asia-Pacific Security (9780415649360) | 1 | Adet |
| Japan`sRelations with Southeast Asia: The Fukuda Doctrine and Beyond(Politics in Asia) (9780415809665) | 1 | Adet |
| Japan`sStrategic Challenges in a Changing Regional Environment(9789814368735) | 1 | Adet |
| Jigand Fixture Design Manual (9780831102111) | 2 | Adet |
| Joiningof Ceramics (Chapman & Hall Medical Atlas Series)(9780412367502) | 2 | Adet |
| Joiningof Materials and Structures: From Pragmatic Process to EnablingTechnology (9780750677578) | 2 | Adet |
| Joiningof Plastics: Handbook for Designers and Engineers (9781569903544) | 2 | Adet |
| JoiningProcesses (9780412793608) | 3 | Adet |
| JoiningProcesses: An Introduction (9780471964889) | 1 | Adet |
| JudsonDance Theater: PerformativeTraces (9780415975735) | 1 | Adet |
| Justice:What`s the right thing to do? (9780374532505) | 1 | Adet |
| KarlTerzaghi (9780784403648) | 1 | Adet |
| KeyConcepts in Childhood Studies (9781446201893) | 1 | Adet |
| Keyneson International Economic Relations (9781162912738) | 1 | Adet |
| Keyneson Monetary Policy, Finance and Uncertainty: Liquidty PreferenceTheory and the Global Financial Crisis (9780415616478) | 1 | Adet |
| KhediveIsmail`s Army (9780415645959) | 1 | Adet |
| Knowingand Teaching Elementary Mathematics: Teachers` Understanding ofFundamental Mathematics in China and the United States(9780415873840) | 1 | Adet |
| Knowledgein Motion: Perspectives of Artistic and Scientific Research inDance (9783899428094) | 1 | Adet |
| LaBible des Anges Tome 1 (9782894362198) | 1 | Adet |
| LaConstruction de soi (9782757826270) | 1 | Adet |
| LaPetite Voix (9782840582892) | 1 | Adet |
| LandPolicies and Their Outcomes (9781558441729) | 1 | Adet |
| Landslides:Types, Mechanisms and Modeling (9781107002067) | 1 | Adet |
| Land-UseModelling in Planning Practice (9789400718210) | 1 | Adet |
| LanguageDevelopment (9781133958352) | 1 | Adet |
| LasermesstechnikDiagnostik der Kurzzeitphysik (9783540299202) | 1 | Adet |
| LaterallyLoaded Deep Foundations: Analysis and Performance (9780803102071) | 1 | Adet |
| LeBibliobus CM 4 oeuvres complètes (9782011164988) | 1 | Adet |
| LeBibliobus CM : 4 oeuvres complètes (9782011173461) | 1 | Adet |
| LeBibliobus CM 4 oeuvres complètes (9782011165008) | 1 | Adet |
| LeBibliobus CM Cycle 3 Contes d`ailleurs (9782011173454) | 1 | Adet |
| LeBibliobus Cycle 3 (9782011164438) | 1 | Adet |
| Learningto Eat Soup with a Knife: Counterinsurgency Lessons from Malayaand Vietnam (9780226567709) | 1 | Adet |
| Learningto Teach Mathematics in the Secondary School: A Companion toSchool Experience (Learning to Teach Subjects in the SecondarySchool Series) (9780415565592) | 1 | Adet |
| LectureNotes in Microeconomic Theory: The Economic Agent(9780691154138) | 1 | Adet |
| LesoonsLearned: Reflection on the Theory (9780892369201) | 1 | Adet |
| LightSources (9781439820797) | 1 | Adet |
| Linden`sHandbook of Batteries (9780071624213) | 1 | Adet |
| LinkedData - A Geographic Perspective (9781439869956) | 1 | Adet |
| LinkedData Tools: Connecting on the Web (9780838958599) | 1 | Adet |
| LinkedData: A Geographic Perspective (9781439869956) | 1 | Adet |
| Listeningin on Museum Conversations (9780759104426) | 1 | Adet |
| LuminescentMaterials (9783540580195) | 1 | Adet |
| Maceconomicsin Emerging Markets (9780521733045) | 1 | Adet |
| MacroeconomicTheory (9780195387711) | 1 | Adet |
| Madrigals,Book VIII: Madrigali Guerrieri et Amorosi (9780486267395) | 1 | Adet |
| Madrigals,Books IV & V (9780486251028) | 1 | Adet |
| MakingSense, Making Worlds: Constructivism in Social Theory andInternational Relations (9780415624176) | 1 | Adet |
| MakingSense: Teaching and Learning Mathematics with Understanding (9782854186055) | 1 | Adet |
| MakingVideo Dance: A Step-by-Step Guide to Creating Dance for the Screen (9780415379427) | 1 | Adet |
| Managementand Preservation of Archeological Sites-Icomos (9758599712) | 1 | Adet |
| ManagementScience in Practice (9780470026649) | 1 | Adet |
| ManagingInnovation: Integrating Technological, Market and OrganizationalChange (9780470998106) | 1 | Adet |
| ManufacturingTechnology 3E: Foundry, Forming and Welding (9780070087989) | 1 | Adet |
| MappingEquity and Quality in Mathematics Education (9789048198023) | 1 | Adet |
| MaryWigman Routledge Performance Practitioners Series (9780415375276) | 1 | Adet |
| MasterHandbook of Acoustics (9780071603324) | 2 | Adet |
| Materialsand Processes in Manufacturing, Selected Chapters (9780471656531) | 3 | Adet |
| Materialsand Skills for Historic Building Conservation (9781405111706) | 1 | Adet |
| MaterialsDevelopment in Language Teaching (9780521762854) | 1 | Adet |
| MathematicalModeling in Science and Engineering (9781118087572) | 1 | Adet |
| MathematicalMorphology in Geomorphology and GISci (9781439872000 ) | 1 | Adet |
| MathematicalMosaic: Patterns and Problem Solving (9781895997040) | 1 | Adet |
| MathematicalOptimization and Economic Analysis (9780387895512) | 1 | Adet |
| MathematicalTheory of Optimal Processes (9782881240775) | 1 | Adet |
| MathematicalThinking and Problem Solving (Studies in Mathematical Thinking andLearning Series) (9780805809909) | 1 | Adet |
| Mathematicsand Science Achievement at South African Schools in TIMSS 2003(9780796921581) | 1 | Adet |
| MathematicsEducation at Highly Effective Schools That Serve the Poor:Strategies for Change (9780805856897) | 1 | Adet |
| MathematicsEducation in Different Cultural Traditions- A Comparative Study ofEast Asia and the West: The 13th ICMI Study (9780387297224) | 1 | Adet |
| MathematicsEducation Research: A Guide for the Research Mathematician(American Mathematics Society non-series title) (9780821820162) | 1 | Adet |
| Mathematicseducation: a handbook for teachers (9780908957101) | 1 | Adet |
| Mathematicseducation: models and processes (9780805814576) | 1 | Adet |
| MathematicsExplained for Primary Teachers (9781848601970) | 1 | Adet |
| Mathematicsfor Elementary Teachers with Activity Manual (9780321825728) | 1 | Adet |
| Mathematics,Education and Philosophy: An International Perspective (Studies inmathematics education) (9780750702904) | 1 | Adet |
| Mathsand ICT in the Primary School: A Creative Approach (9781843123774) | 1 | Adet |
| Measurementand Detection of Radiation, Third Edition [Hardcover] (9781420091854) | 1 | Adet |
| MechanicalVibrations (9781461404590) | 1 | Adet |
| MedicinalNatural Products: A Biosynthetic Approach (9780471496410) | 1 | Adet |
| Mercenaries,Pirates, and Sovereigns (9780691025711) | 1 | Adet |
| MerchantKings: When Companies Ruled the World, 1600--1900 (9780312616113) | 1 | Adet |
| MetallurgicalModelling of Welding (Materials Modelling Series) (9781861250360) | 1 | Adet |
| MicroeconomicFoundations I: Choice and Competitive Markets (9780691155838) | 2 | Adet |
| MicroeconomicTheory: Basic Principles and Extension (9781111525514) | 1 | Adet |
| Microeconomics:Behavior, Institutions, and Evolution (9780691126388) | 1 | Adet |
| Microwavephotonics (9780849339240) | 1 | Adet |
| Militarismand the British Left, 1902-1914 (9781137274120) | 1 | Adet |
| MilitaryEffectiveness (Volume 1) (9780521737494) | 1 | Adet |
| MilitaryEffectiveness (Volume 2) (9780521737500) | 1 | Adet |
| MilitaryEffectiveness (Volume 3) (9780521737517) | 1 | Adet |
| MilitaryPower: Explaining Victory and Defeat in Modern Battle(9780691128023) | 1 | Adet |
| Minimizationof Welding Distortion and Buckling: Modelling and Implementation(Woodhead Publishing in Materials) (9781845696627) | 1 | Adet |
| Missbrauchder aktienrechtlichen Anfechtungsklage (9783725540563) | 1 | Adet |
| Modeling,Control and Coordination of Helicopter Systems (9781461415626) | 1 | Adet |
| Modeling,Sensing and Control of Gas Metal Arc Welding (9780080440668) | 1 | Adet |
| ModellingTransport (9780470760390) | 2 | Adet |
| MODERNOPTICS AND PHOTONICS (9789814313261) | 1 | Adet |
| ModernOptical Engineering (9780071476874) | 2 | Adet |
| ModernOptical Spectroscopy With Examples from Biophysics andBiochemistry (9783540375357) | 1 | Adet |
| ModernWarfare: A French View of Counterinsurgency (9780275992682) | 1 | Adet |
| MolecularQuantum Mechanics (9780199541423) | 2 | Adet |
| Moltkeand the German Wars, 1864-1871 (9780333687581) | 1 | Adet |
| MoneyMatters: Macroeconomics and Financial Markets (9788132105329) | 1 | Adet |
| Moraljudgment and social education (9781412813396) | 1 | Adet |
| MulticriteriaAnalysis for Land-Use Management (9789048150779) | 1 | Adet |
| MulticriteriaDecision Analysis in Geographic Information Science Series:Advances in Geographic Information Science (9783540747567) | 1 | Adet |
| Multipolarityin the 21st Century: A New World Order (9780415475471) | 1 | Adet |
| MunicipalRevenues and Land Policies (9781558442085) | 1 | Adet |
| MuseumExperience Revisited (9781611320459) | 1 | Adet |
| Museumsand Families (9781598740769) | 1 | Adet |
| NANOBIOPHOTONICS Science and Technology (9780444528780) | 1 | Adet |
| NANOPHOTONICSWITH SURFACE PLASMONS (9780444528384) | 1 | Adet |
| NanophotonicDevices for Linear and Nonlinear Optical Singal Proccessing(9783866441781) | 1 | Adet |
| NanophotonicMaterials, Photonic Crystals, Plasmonics, and Metamaterials(9783527408580) | 1 | Adet |
| NANOSTRUCTURESIN ELECTRONICS AND PHOTONICS (9789814241106) | 1 | Adet |
| NationalScience Education Standards (9780309053266) | 1 | Adet |
| Nations:The Long History and Deep Roots of Political Ethnicity andNationalism (9781107007857) | 1 | Adet |
| NaturalProducts (9788187224853) | 1 | Adet |
| Naturalproducts chemistry. 3 (9780935702149) | 1 | Adet |
| NaturalProducts from Plants, Second Edition (9780849329760) | 1 | Adet |
| NaturalProducts: Chemistry and Applications (9781842654057) | 1 | Adet |
| Naturalproducts: chemistry, biochemistry and pharmacology (9781842654507) | 1 | Adet |
| Naturalproducts: their chemistry and biological significance(9780582060098) | 1 | Adet |
| NEWACTORS OF NEW POVERTY: THE "OTHER" CHILDREN OF CUKUROVA(9783836474740) | 1 | Adet |
| Newand Old Wars: Organized Violence in a Global Era (9780804756464) | 1 | Adet |
| NewGerman Dance Studies (9780252036767) | 1 | Adet |
| NewTeacher Identity and Regulative Government: The DiscursiveFormation of Primary Mathematics Teacher Education (9780387239712) | 1 | Adet |
| NewWars (9780745633374) | 1 | Adet |
| NGOsand Social Responsibility (Developments in Corporate Governanceand Responsibility) (9780857242952) | 1 | Adet |
| NonLinear Optics (9780824709655) | 1 | Adet |
| NondestructiveTesting of Deep Foundations (9780470848500) | 1 | Adet |
| NonlinearOptical Crystals:A Complete Survey (9780387220222) | 1 | Adet |
| NonlinearOptics (9780123694706) | 1 | Adet |
| NonlinearPhysics with Mathematica for Scientists and Engineers(9780817642235) | 1 | Adet |
| NuclearWeapons and Cooperative Security in the 21st Century(9780415622240) | 1 | Adet |
| ObjectOriented Design and Patterns (9780471744870) | 1 | Adet |
| OceanAmbient Noise-Measurement and Theory (9781441978318) | 1 | Adet |
| OnForeign Policy: Unfinished Business / Edition 1 (9781594512643) | 1 | Adet |
| Onthe analysis of two-person problem solving protocols | 1 | Adet |
| Onthe Edge (9780192753717) | 5 | Adet |
| Ontology-DrivenTranslation of Geospatial Data (9781607500711) | 1 | Adet |
| OperationsControl Systems in Public Transport (9783878148012) | 1 | Adet |
| OPTICALIMAGING AND SPECTROSCOPY (9780470048238) | 1 | Adet |
| OPTICSPrinciples and Applications (9780123706119) | 3 | Adet |
| OpticalMetamaterials Fundamentals and Applications (9781441911506) | 1 | Adet |
| Opticalproperties of condensed matter and applications (9780470021927) | 1 | Adet |
| OpticalProperties of Nanoparticle Systems (9783527410439) | 1 | Adet |
| OpticalProperties of Semiconductor Nanocrystals (9780521582414) | 1 | Adet |
| OpticalProperties of Solids (9780198506133) | 1 | Adet |
| Optomechatronics(9780849319693) | 2 | Adet |
| OrganicStructure Determination Using 2-D NMR Spectroscopy:(9780123849700) | 1 | Adet |
| Orientalismand War (9781849042086) | 1 | Adet |
| OxyacetyleneWelding: Basic Fundamentals (9780870069130) | 2 | Adet |
| PadagogischePsychologie (9783540885726) | 4 | Adet |
| Paratransitin America: Redefining Mass Transportation (9780275957254) | 1 | Adet |
| PavementManagement and Rehabilitation (Transportation Research Record)(9780309048194) | 1 | Adet |
| PHASECONJUGATE LASER OPTICS (9780471439578) | 1 | Adet |
| Photonics:Optical Electronics in Modern Communications (9780195179460) | 1 | Adet |
| Photovoltaics:Design and Installation Manual (9780865715202) | 1 | Adet |
| Physicsof Organic Semiconductors (9783527405503) | 2 | Adet |
| Physicsof Solar Cells (9783527404285) | 2 | Adet |
| Physicsof Solid State Lasers (9781898326175) | 1 | Adet |
| PIDControllers: Theory, Design and Tuning (9781556175169) | 1 | Adet |
| Pilesand Pile Foundations (9780415490665) | 1 | Adet |
| Pilingin Rock (9789061915867) | 1 | Adet |
| Piling:European practice and worldwide trends (9780727735645) | 1 | Adet |
| Plant-derivedNatural Products (9780387854977) | 1 | Adet |
| PowerfulLearning: What We Know About Teaching for Understanding(9780470276679) | 1 | Adet |
| PracticalFoundation Engineering Handbook (9780071351393) | 1 | Adet |
| Precisionmachine design (9780872634923) | 1 | Adet |
| Principlesand Applications of Lithium Secondary Batteries (9783527331512) | 1 | Adet |
| Principlesof Helicopter Aerodynamics (9780521858601) | 1 | Adet |
| Principlesof nanophotonics (9781584889724) | 3 | Adet |
| Principlesof Naval Architecture Series: Intact Stability (9780939773749) | 1 | Adet |
| Principlesof Naval Architecture Series: Propulsion (9780939773831) | 1 | Adet |
| Principlesof Naval Architecture Series: Strength of Ships and OceanStructures (9780939773664) | 1 | Adet |
| Principlesof Naval Architecture Series: The Geometry of Ships(9780939773671) | 1 | Adet |
| Principlesof Naval Architecture Series: Vibration (9780939773756) | 1 | Adet |
| Principlesof Naval Architecture: Ship Resistance & Flow (9780939773763) | 1 | Adet |
| ProblemSolving (9780415202992) | 1 | Adet |
| ProblemSolving in Mathematics, Grades 3-6: Powerful Strategies to DeepenUnderstanding (9781412960670) | 1 | Adet |
| ProblemSolving Mathematics (9781875268252) | 1 | Adet |
| ProblemSolving Strategies (Steck-Vaughn Start Smart) (9780739860168) | 1 | Adet |
| ProblemSolving Strategies: Crossing the River With Dogs and OtherMathematical Adventures (9781559533713) | 1 | Adet |
| ProblemSolving Strategies: Grade 5 (9781419005169) | 1 | Adet |
| ProblemSolving Strategies: (9780964761100) | 1 | Adet |
| ProblemSolving Year 3 Teachers Book (NUMERACY EXTRAS) (9780602306953) | 1 | Adet |
| Problemsof Number Theory in Mathematical Competitions (9789814271141) | 1 | Adet |
| Problem-SolvingStrategies (Problem Books in Mathematics (9780387982199) | 1 | Adet |
| Problem-solvingstrategies for efficient and elegant solutions, grades 6-12:(9781412959704) | 1 | Adet |
| Problem-solvingstrategies for writing (9780155001701) | 1 | Adet |
| Problem-solvingstrategies: use by Australian children with Australian and Greekparentage | 1 | Adet |
| Progressand New Trends in 3D Geoinformation Sciences Series: Lecture Notesin Geoinformation and Cartography (9783642297922) | 1 | Adet |
| Progressin educational psychology research (9781600217869) | 2 | Adet |
| Progressin Location-Based Services Series: Lecture Notes in Geoinformationand Cartography (9783642342028) | 1 | Adet |
| ProgressiveMuseum Practice: John Dewey and Democracy (9781598744811) | 1 | Adet |
| ProjectManagement: A Systems Approach to Planning, Scheduling andControlling (9780470278703) | 1 | Adet |
| ProspectTheory and Foreign Policy Analysis in the Asia Pacific(9780415656214) | 1 | Adet |
| Psychogieund Psychotherapie für Scuhle und Studium (9783211336205) | 4 | Adet |
| PsychologischeFörder- und Interventionsprogramme für das Kindes- undJugendalter (9783540883838) | 1 | Adet |
| Psychology,Strategy and Conflict: Perceptions of Insecurity in InternationalRelations (9780415622042) | 1 | Adet |
| PublicPhilosophy: Essays on Morality of Politics (9780674023659) | 1 | Adet |
| Public-PrivatePartnerships: Case Studies on Infrastructure Development(9780784410134) | 1 | Adet |
| PythonScripting for ArcGIS (9781589482821) | 1 | Adet |
| Quanta,Matter, and Change A molecular approach to physical chemistry(9780716761174) | 5 | Adet |
| QuantumComputation, Quantum Error Correcting Codes and Information Theory(9788173196881) | 1 | Adet |
| QuantumOptics an Introduction (9780198566731) | 1 | Adet |
| Quaternionsand Cayley Numbers:Algebra and Applications (9780792345138) | 1 | Adet |
| RadiationDetection and Measurement [Hardcover] (9780470131480) | 3 | Adet |
| RadiationScience for Physicians and Public Health Workers [Hardcover] (9780306464034) | 2 | Adet |
| RadiationTherapy Planning [Paperback] (9780070051157) | 2 | Adet |
| RAILROADSAND RIFLES: Soldiers, Technology and the Unification of Germany(9781909384194) | 1 | Adet |
| RailwayTrack Engineering (4th Ed.) (9780070680128) | 1 | Adet |
| RailwayTransportation: Engineering, Operation and Management(9781842656853) | 1 | Adet |
| RainMan (9783526417859) | 5 | Adet |
| RamanAmplification in Fiber Optica Communication Systemsl(9780120445066) | 1 | Adet |
| RapidLoad Testing on Piles (9780415482974) | 1 | Adet |
| RealAnalysis with Economic Applications (9780691117683) | 1 | Adet |
| RecentAdvancement in Soil Behavior, In Situ Test Methods, PileFoundations, and Tunneling (GSP192) (9780784410448) | 1 | Adet |
| RecentAdvances in Welding and Joining: SP-1842 (9780768013788) | 2 | Adet |
| Reformingthe Tsar`s Army: Military Innovation in Imperial Russia from Peterthe Great to the Revolution (9780521174435) | 1 | Adet |
| REHEARSINGCOLLECTIVITY - Choreography Beyond Dance (9783942700221) | 1 | Adet |
| Relationscapes- Movement, Art, Philosophy (9780262134903) | 1 | Adet |
| RenegadeRegimes and Foreign Policy Crises (9783639453416) | 1 | Adet |
| Researchfor Materials Development in Language Learning: Evidence For BestPractice (9781441122933) | 1 | Adet |
| Researchin Collegiate Mathematics Education I: v. 1 (CBMS Issues inMathematics Education) (9780821835043) | 1 | Adet |
| Researchin Collegiate Mathematics Education II: Vol 2 (CBMS Issues inMathematics Education) (9780821803820) | 1 | Adet |
| Researchin Collegiate Mathematics Education. III: v. 3 (CBMS Issues inMathematics Education) (9780821808825) | 1 | Adet |
| Researchin Collegiate Mathematics Education. VI: v. 6 (CBMS Issues inMathematics Education) (9780821842430) | 1 | Adet |
| ResearchMethods in Applied Linguistics (9780194422581) | 1 | Adet |
| ResearchingMathematics Education in South Africa: Perspectives, Practices andPossibilities (9780796920478) | 1 | Adet |
| ResistanceWelding: Fundamentals and Applications, Second Edition(9781439853719) | 4 | Adet |
| RethinkingMaps: New Frontiers in Cartographic Theory (9780415461528) | 1 | Adet |
| RethinkingMilitary History (9780415275347) | 1 | Adet |
| RethinkingRealism in International Relations: Between Tradition andInnovation (9780801892868) | 1 | Adet |
| Rethinkingthe Principles of War (9781591144823) | 1 | Adet |
| Reuseof Foundations for Urban Sites (9781860819391) | 1 | Adet |
| RobotSumo: The Official Guide (9780072226171) | 1 | Adet |
| Robotics,Vision and Control: Fundamental Algorithms in MATLAB(9783642201431) | 1 | Adet |
| RobustAdaptive Control (9780486498171) | 1 | Adet |
| Robustcontrol : the parameter space approach (9781852335144) | 1 | Adet |
| RockSlope Engineering (9780415280013) | 1 | Adet |
| Roleof Seismic Testing Facilities in Performance-Based EarthquakeEngineering Seires WorkShop (9789400719767) | 1 | Adet |
| Russiaas a Great Power: Dimensions of Security Under Putin(9780415651578) | 1 | Adet |
| RussianMathematics Education: History And World Significance (Series onMathematics Education) (9789814277051) | 1 | Adet |
| Scalein Spatial Information and Analysis (9781439829370) | 1 | Adet |
| SchoolCounseling Principles: Ethics and Law (9781929289172) | 1 | Adet |
| SchoolingIn Capitalist America: Educational Reform and the Contradictionsof Economic Life (9781608461318) | 1 | Adet |
| SchweizerAktienrecht (9783725558469) | 1 | Adet |
| ScienceFormative Assessment () (9781412941792) | 1 | Adet |
| Scrapingthe Barrel: The Military Use of Sub-Standard Manpower(9780823239771) | 1 | Adet |
| Secondarymetabolites: their function and evolution (9780471934479) | 1 | Adet |
| SeismicBehaviour and Design of Irregular and Complex Civil Structures(Geotechnical, Geological and Earthquake Engineering)(9789400753761) | 1 | Adet |
| SeismicDesign Aids for Nonlinear Pushover Analysis of Reinforced Concreteand Steel Bridges (Advances in Earthquake Engineering)(9781439837634) | 1 | Adet |
| SelectedGeotechnical Papers of James K. Mitchell (9780784405673) | 1 | Adet |
| SemiconductorLasers Fundementals (9783540641667) | 1 | Adet |
| SemiconductorOptics (9783642283611) | 1 | Adet |
| Senseand Sensibility (9780486290492) | 5 | Adet |
| ServiceOriented Mapping 2012 (9783950203923) | 1 | Adet |
| Shatterzoneof Empires: Coexistence and Violence in the German, Habsburg,Russian, and Ottoman Borderlands (9780253006356) | 1 | Adet |
| SILICONNANOPHOTONICS Basic Principles, Present Status and Perspectives(9789814241113) | 1 | Adet |
| SiliconPhotonics An Introduction (9780470870341) | 1 | Adet |
| SimulatingProcess and Pattern: A Spatial Perspective (9781119970804) | 1 | Adet |
| SimultaneousLocalization and Mapping: Exactly Sparse Information Filters(9789814350310) | 1 | Adet |
| SlopeStability Analysis and Stabilization: New Methods and Insight (9780415421720) | 1 | Adet |
| SlopeStability, Retaining Walls, and Foundations (GSP197)(9780784410493) | 1 | Adet |
| SoftGround Improvement in Lowland and Other Environments: In Lowlandand Other Environments (9780784401514) | 1 | Adet |
| SoftwareArchitecture in Practice (3rd Edition) (9780321815736) | 1 | Adet |
| SoftwareArchitecture: Foundations, Theory, and Practice (9780470167748) | 1 | Adet |
| SoftwareEngineering (9780137053469) | 2 | Adet |
| Soiland Foundations (9780132221382) | 1 | Adet |
| SoilBehavior and Geo-Micromechanics (GSP200) (9780784411018) | 1 | Adet |
| SoilConstitutive Models (GSP128) (9780784407714) | 1 | Adet |
| SoilDynamics and Earthquake Engineering (GSP201) (9780784411025) | 1 | Adet |
| SoilDynamics and Liquefaction 2000 (GSP107) (9780784405208) | 1 | Adet |
| SoilProperties: Testing, Measurement, and Evaluation .6.ed(9780136141235) | 1 | Adet |
| Soilsand Rock Instrumentation, Behavior, and Modeling (194)(9780784410462) | 1 | Adet |
| SoilsMagic (9780784405680) | 1 | Adet |
| SolarElectricity Handbook - 2012 Edition: A Simple Practical Guide toSolar Energy - Designing and Installing Photovoltaic SolarElectric Systems (9781907670183) | 1 | Adet |
| Soldering,Brazing and Welding (9781861263919) | 2 | Adet |
| Soldiersof Labor: Labor Service in Nazi Germany and New Deal America,1933-1945 ( (9780521168663) | 1 | Adet |
| Soldiers`Tales: Two Palestinian Jewish Soldiers in the Ottoman Army duringthe First World War (9780853039563) | 1 | Adet |
| SolidState Physics (9780123044600) | 1 | Adet |
| SolidWorks2013 Part I - Basic Tools (9781585037681) | 1 | Adet |
| SolidWorks2013 Part II - Advanced Techniques (9781585037704) | 1 | Adet |
| SolvingProblems with NMR Spectroscopy (9780120663200) | 1 | Adet |
| SoundGeotechnical Research to Practice (GSP230) (9780784412770) | 1 | Adet |
| Sovereigntyand the Responsibility to Protect (9780415626293) | 1 | Adet |
| Spatialand Spatio-temporal Data Analysis (9781848214682) | 1 | Adet |
| SpatialMathematics: Theory and Practice through Mapping | 1 | Adet |
| Specificationfor tunnelling (9780727728654) | 1 | Adet |
| SpectralAnalysis and Time Series (9780125649223) | 1 | Adet |
| Spinoza: Briefwechsel (9783864711848) | 1 | Adet |
| SpreadsheetModeling and Applications: Essentials of Practical ManagementScience (9780534380328) | 1 | Adet |
| St.John Passion BWV 245 - Complete edition, Score, Urtext edition(9790006462155) | 2 | Adet |
| St.Matthew Passion BWV 244 - Complete edition, Score, Urtext edition(9790006462285) | 2 | Adet |
| StandardHandbook of Fastening and Joining (9780070485891) | 2 | Adet |
| Standards-BasedSchool Mathematics Curricula: What Are They? What Do StudentsLearn? (9780805850284) | 1 | Adet |
| States,Citizens and the Privatisation of Security (9780521125192) | 1 | Adet |
| StatisticalDistributions, 4th Edition (9780470390634) | 1 | Adet |
| StatisticalMethods for Fuzzy Data (9780470699454) | 1 | Adet |
| StatisticalPattern Recognition, 3rd Edition (9780470682272) | 1 | Adet |
| StatisticsTranslated (9781462503018) | 1 | Adet |
| SteamPlant Operation (9780071667968) | 1 | Adet |
| StrategicGIS Planning and Management in Local Government (9781466556508) | 1 | Adet |
| Stratgiesfor Creative Problem Solving (9780130082794) | 1 | Adet |
| StructuralSensing, Health Monitoring, and Performance Evaluation(9780750309196) | 1 | Adet |
| Structuresand Conservation in Historic Buildings (9781405111713) | 1 | Adet |
| StudentAssessment in Calculus: A Report of the Nsf Working Group onAssessment in Calculus (9780883851524) | 1 | Adet |
| StudentSolutions Manual with Study Guide for Burden/Faires` NumericalAnalysis (9780538735636) | 2 | Adet |
| Studiesin crisis behavior (9780878552924) | 1 | Adet |
| Studiesin Modern Childhood: Society, Agency, Culture(9781403939333) | 1 | Adet |
| Succeedingat Teaching Secondary Mathematics: Your First Year (9781412927635) | 1 | Adet |
| SuccessfulCollege Teaching:Problem-Solving Strategies of DistinguishedProfessors (9780205266548) | 1 | Adet |
| SupplyChain Network Design: Applying Optimization and Analytics to theGlobal Supply Chain (9780133017373) | 1 | Adet |
| SupplyingWar: Logistics from Wallenstein to Patton (9780521546577) | 1 | Adet |
| Sustainability:Utilizing Lean Six Sigma Techniques (9781466514249) | 1 | Adet |
| SustainableDevelopment in Practice: Case Studies for Engineers andScientists, 2nd Edition (9780470718711) | 1 | Adet |
| SustainableTransportation Systems: Plan, Design, Build, Manage, and Maintain (9780784412299) | 2 | Adet |
| SymphonyFantastique and Harold in Italy in Full Score (9780486246574) | 2 | Adet |
| Synergetics(9783642074059) | 1 | Adet |
| SyntacticIslands (9780521138789) | 1 | Adet |
| SystemAnalysis and Design (9780470228548) | 2 | Adet |
| SystemAnalysis and Design (9780273749929) | 1 | Adet |
| SystemsAnalysis and Design with UML, (9781118037423) | 1 | Adet |
| Teachers`Use of Mathematics Curriculum Materials (Studies in MathematicalThinking and Learning Series) (9780415990103) | 1 | Adet |
| Teachingelementary school mathematics for understanding (9780070404236) | 1 | Adet |
| TeachingLearners Who Struggle with Mathematics: Systematic Interventionand Remediation (9780136135777) | 1 | Adet |
| TeachingMathematics (9780893971373) | 1 | Adet |
| TeachingMathematics (Open University Postgraduate Certificate in EducationCourse Readers) (9780415102520) | 1 | Adet |
| TeachingMathematics 3-5: Developing learning in the Foundation Stage (9780335216864) | 1 | Adet |
| TeachingMathematics Creatively (Learning to Teach in the Primary SchoolSeries) (9780415575911) | 1 | Adet |
| TeachingMathematics in Colleges and Universities: Case Studies for Today`sClassroom: Faculty Edition (CBMS Issues in Mathematics Education)(9780821828755) | 1 | Adet |
| TeachingMathematics in the Block (9781883001513) | 1 | Adet |
| TeachingMathematics Meaningfully: Solutions for Reaching StrugglingLearners (9781557668660) | 1 | Adet |
| TeachingMathematics to All Children: Designing and Adapting Instruction toMeet the Needs of Diverse Learners (2nd Edition) (9780131175747) | 1 | Adet |
| Teachingmathematics to children with special needs (9780201077285) | 1 | Adet |
| TeachingMathematics to Middle School Students with Learning Difficulties(What Works for Special-needs Learners) (9781593853068) | 1 | Adet |
| TeachingMathematics Today (Practical Strategies for Successful Classrooms)(9781425803766) | 1 | Adet |
| TeachingMathematics with Insight: Identification, Diagnosis andRemediation of Young Children`s Mathematical Errors (9780750708036) | 1 | Adet |
| Teachingmathematics: a handbook for primary and secondary school teachers(9780415335171) | 1 | Adet |
| TeachingMathematics: A Sourcebook of Aids, Activities, and Strategies(9780205292561) | 1 | Adet |
| TeachingMaths to Pupils with Different Learning Styles (9781412903592) | 1 | Adet |
| TeachingProblem Solving through Childrens Literature (9781563089817) | 1 | Adet |
| Teachingproblem-solving strategies (9780201102314) | 1 | Adet |
| TeachingSecondary and Middle School Mathematics (9780205569199) | 1 | Adet |
| TeachingSecondary Mathematics (9780805854718) | 1 | Adet |
| TeachingSecondary Mathematics: Techniques and Enrichment Units(9780135000038) | 1 | Adet |
| TeachingStatistics in School Mathematics-Challenges for Teaching andTeacher Education: A Joint ICMI/IASE Study: The 18th ICMI Study(New ICMI Study (9789400711303) | 1 | Adet |
| Teachingstudent-centered mathematics (9780132824828) | 1 | Adet |
| TerahertzSpectroscopy Principles and Applications (9780849375255) | 1 | Adet |
| TestingAdhesive Joints: Best Practices (9783527329045) | 2 | Adet |
| The"BASIC Ph" Model of Coping and Resiliency: Theory,Research and Cross ... (9781849052313) | 4 | Adet |
| TheAASHO Road Test Report 5: Pavement Research; By The HighwayResearch Board Of The NAS-NRC Division Of Engineering AndIndustrial Research Speci | 1 | Adet |
| TheAccidental Guerrilla: Fighting Small Wars in the Midst of a BigOne (9780199754090) | 1 | Adet |
| TheAmerican Culture of War: A History of US Military Force from WorldWar II to Operation Enduring Freedom (9780415890199) | 1 | Adet |
| TheApplication of Stress-Wave Theory to Piles (9781586039097) | 1 | Adet |
| TheArab Revolution: Ten Lessons from the Democratic Uprising (9780199898299) | 1 | Adet |
| TheAshgate ResearchCompanion to US Foreign Policy (9780754648628) | 1 | Adet |
| TheAsian Military Revolution: From Gunpowder to the Bomb(9780521846820) | 1 | Adet |
| TheBalkan Wars in the Eyes of the Warring Parties: Perceptions andInterpretations (9781475947038) | 1 | Adet |
| TheBiosynthesis of Secondary Metabolites (9780412277207) | 1 | Adet |
| TheBush Leadership,the Power of Ideas and the War on Terror(9781409447153) | 1 | Adet |
| TheByzantine Wars (9780752445656) | 1 | Adet |
| TheCambridge Companion to Ballet (9780521539869) | 1 | Adet |
| TheCambridge Illustrated History of the British Empire (9780521002547) | 1 | Adet |
| TheCarole: A Study of a Medieval Dance (9781409412489) | 1 | Adet |
| TheClash of Ideologies: Middle Eastern Politics and American Security(9780199838448) | 1 | Adet |
| TheCoding Manual for Qualitative Researchers (9781446247372) | 1 | Adet |
| TheCold War: A Military History (9780812967166) | 1 | Adet |
| TheComing of the Book: The Impact of Printing, 1450-1800(9781844676347) | 1 | Adet |
| TheConservation of Archeological Sites (9780892364862) | 1 | Adet |
| TheCrown of Violet (9780571269952) | 5 | Adet |
| TheCulture of Defeat: On National Trauma, Mourning, and Recovery(9780312423193) | 1 | Adet |
| TheDancer`s Quest: Essays on the Aesthetic of the Contemporary Dance(9781258044190) | 1 | Adet |
| TheDecision Point: Six Cases in U. S. Foreign Policy Decision Making(9780199743520) | 1 | Adet |
| TheDomestic Sources of American Foreign Policy: Insights and Evidence(9781442209619) | 1 | Adet |
| TheDurable Corporation (9780566088193) | 1 | Adet |
| TheDutch Republic: Its Rise, Greatness, and Fall 1477-1806(9780198207344) | 1 | Adet |
| TheDynamics of Military Revolution, 1300-2050 (9780521800792) | 1 | Adet |
| TheEthics of Research with Children and Young People: A PracticalHandbook (9780857021373) | 1 | Adet |
| TheEvolution of International Security Studies (9780521694223) | 1 | Adet |
| TheFace of Battle: A Study of Agincourt, Waterloo, and the Somme(9780140048971) | 1 | Adet |
| TheFailure of Risk Management: Why It`s Broken and How to Fix It (9780470387955) | 1 | Adet |
| TheFuture of Childhood (9780415256759) | 1 | Adet |
| TheGIS Guide to Public Domain Data | 1 | Adet |
| TheGovernance of Risk (Developments in Corporate Governance andResponsibility) (9781781907801) | 1 | Adet |
| TheGrid: A Journey Through the Heart of Our Electrified World(9780309102605) | 1 | Adet |
| TheHistory of Education (9781162697239) | 1 | Adet |
| TheInsurgents: David Petraeus and the Plot to Change the American Wayof War (9781451642636) | 1 | Adet |
| TheMathematics of Minkowski Space-Time: With an Introduction toCommutative Hypercomplex Numbers (Frontiers in Mathematics) (9783764386139) | 1 | Adet |
| TheMusic Theory Handbook (9780155026629) | 2 | Adet |
| TheNew Economics of Inequality and Redistribution (Federico CaffèLectures) (9781107601604) | 1 | Adet |
| TheNuclear Many-Body Problem (Theoretical and Mathematical Physics) (9783540212065) | 1 | Adet |
| TheOttoman Mobilization of Manpower in the First World War: BetweenVoluntarism and Resistance (9789004225206) | 1 | Adet |
| ThePalgrave Handbook of Childhood Studies (9780230532618) | 1 | Adet |
| THEPHYSICS OF EVERYDAY PHENOMENA: A CONCEPTUAL INTRODUCTION TOPHYSICS (9780071315340) | 3 | Adet |
| Thephysics of laser-atom interactions (9780521462396) | 1 | Adet |
| ThePhysics of Radiation Therapy [Hardcover] (9780781788564) | 2 | Adet |
| Thepicture of dorian gray (9780486278070) | 5 | Adet |
| ThePractice of Soil Reinforcing in Europe (9780727720832) | 1 | Adet |
| ThePresent Author - Who Speaks in Performance? (9783868953596) | 1 | Adet |
| TheProcess of Software Architecting (9780321357489) | 1 | Adet |
| ThePsychology of Problem Solving (9780521797412) | 1 | Adet |
| TheQuality of Qualitative Research (9780761955986) | 1 | Adet |
| TheRaman Effect (9780471490289) | 1 | Adet |
| TheReal and Assumed Personalities of Famous Men: Rafael De Nogales,T. E. Lawrence, and the Birth of the Modern Era, 1914-1937[(9781903656976) | 1 | Adet |
| TheRegulars: The American Army 1898-1941 (9780674024021) | 1 | Adet |
| TheRoutledge Handbook of New Security Studies (9780415539333) | 1 | Adet |
| TheScience and Engineering of Materials (9780495668022) | 1 | Adet |
| TheScience of Flavonoids (9780387745503) | 1 | Adet |
| TheSociology of Childhood (9781412979436) | 1 | Adet |
| TheSociology of Mathematics Education: Mathematical Myths/PedagogicTexts (Studies in Mathematics Education) (9780750707916) | 1 | Adet |
| TheSoldier and the Changing State: Building Democratic Armies inAfrica, Asia, Europe, and the Americas (9780691137698) | 1 | Adet |
| TheSoldier and the State (9780674817364) | 1 | Adet |
| TheSyrian Rebellion (9780817915049) | 1 | Adet |
| TheTheory and Practice of Revenue Management (International Series inOperations Research & Management Science) (9780387243764) | 2 | Adet |
| TheThermodynamics of Phase and Reaction Equilibria (9780444594976) | 1 | Adet |
| TheThirtly-Nine Steps (9780140624069) | 5 | Adet |
| TheTools of Empire: Technology and European Imperialism in theNineteenth Century (9780195028324) | 1 | Adet |
| TheUnited Nations in the 21st Century (9780813345383) | 1 | Adet |
| TheUnited States and Coercive Diplomacy (9781929223442) | 1 | Adet |
| TheUse of Historical Data in Natural Hazard Assessments(9780792371540) | 1 | Adet |
| TheVietnam War: A Concise International History (9780199753932) | 1 | Adet |
| TheVisualisation of Spatial Social Structure (9781119962939) | 1 | Adet |
| TheWestern Way of War (9780520260092) | 1 | Adet |
| Theatresof Memory (v. 1) (9781859840771) | 1 | Adet |
| TheMakersof Modern Dance in Germany: RudolfLaban, Mary Wigman, Kurt Joos(9780871272508) | 1 | Adet |
| TheorisingSocial Exclusion - (9780415475846) | 1 | Adet |
| Theoryfor Performance Studies: A Student`s Guide (9780415974523) | 1 | Adet |
| Thin-FilmOptical Filters (9780750306881) | 1 | Adet |
| TimeHonored (9780470260494) | 1 | Adet |
| TimetablePlanning & Information Quality (9781845645007) | 1 | Adet |
| Together:The Rituals, Pleasures and Politics of Cooperation (9780300116335) | 1 | Adet |
| Toolsfor Thinking: Modelling in Management Science, 3rd Edition(9780470721421) | 1 | Adet |
| TowardEquity in Quality in Mathematics Education (9781441905574) | 1 | Adet |
| Towardsa Sociology for Childhood (9780335208425) | 1 | Adet |
| TowardsGender Equity in Mathematics Education: An ICMI Study (New ICMIStudy Series) (9780792339212) | 1 | Adet |
| TrackCompendium (9783777104218) | 1 | Adet |
| Trafficand Industrial Environmental Issues: New Concern for DevelopingCountries [Paperback] (9781606924730) | 1 | Adet |
| TransnationalSoldiers: Foreign Military Enlistment in the Modern Era(9780230319684) | 1 | Adet |
| TransportPhenomena in Biological Systems, Second Edition (9780135131541) | 1 | Adet |
| TUNABLELASER OPTICS (9780122226960) | 1 | Adet |
| TunnelEngineering Handbook (9781461380535) | 1 | Adet |
| Tunnellingin Weak Rocks, Volume 5 (Geo-Engineering Book Series)(9780080449876) | 1 | Adet |
| Tunnels& Underground Structures (9789058091710) | 1 | Adet |
| Turkeybetween Nationalism and Globalization (9780415529235) | 1 | Adet |
| Twilightat Conner Prairie: The Creation, Betrayal, and Rescue of a Museum(American Association for State and Local History) (9780759120105) | 1 | Adet |
| UAVCooperative Decision and Control Challenges and PracticalApproaches (9780898716641) | 1 | Adet |
| ULTRAFASTOPTICS (9780471415398) | 1 | Adet |
| UML2.0 in a Nutshell (9780596007959) | 1 | Adet |
| UMLand Data Modeling: A Reconciliation (9781935504191) | 1 | Adet |
| UNDERGROUNDEXCAVATION IN ROCK (9780900488559) | 1 | Adet |
| Understandingand teaching mathematics in the primary school | 1 | Adet |
| UnderstandingDifferent Geographies Series: Lecture Notes in Geoinformation andCartography (9783642297694) | 1 | Adet |
| UnderstandingGlobal Social Policy (9781861349439) | 1 | Adet |
| UnderstandingModern Warfare (9780521700382) | 1 | Adet |
| UnderstandingSocial Exclusion (9780199251940) | 1 | Adet |
| UnderstandingSolids The Science of Materials (9780470852750) | 5 | Adet |
| Understandingthe process of economic change in Turkey : an institutionalapproach (9781608769452) | 1 | Adet |
| Undertraining– On A Contemporary Dance (9782840664390) | 1 | Adet |
| UnequalChances: Family Background and Economic Success (9780691136202) | 1 | Adet |
| Unipolarityand World Politics: A Theory and its Implications (9780415642002) | 1 | Adet |
| UnitOperations of Particulate Solids: Theory and Practice(9781439849071) | 1 | Adet |
| UniversalOntology of Geographic Space: Semantic Enrichment for Spatial Data(9781466603271) | 1 | Adet |
| UrbanColourscape Planning: A Colour Study of the Architecture ofKarlskrona [Paperback] (9783838313283) | 1 | Adet |
| UrbanLand Markets (9781402088612) | 1 | Adet |
| UrbanPlanning For Dummies (9781118100233) | 1 | Adet |
| UsingHistory to Teach Mathematics: An International Perspective (NewMathematical Library (9780883851630) | 1 | Adet |
| UsingInformation Technology in Mathematics Education (9780789013767) | 1 | Adet |
| Usingthe Standards: Problem Solving (9780742418219) | 1 | Adet |
| VerklarteNacht and Pierrot Lunaire (9780486278858) | 1 | Adet |
| VerschiedeneKammermusikwerke by Johann Sebastian Bach (9790006545223) | 1 | Adet |
| Vietnamat War (9780199657988) | 1 | Adet |
| Vinkulierungnicht börsenkotierter Aktien (9783725535798) | 1 | Adet |
| Voicesof the New Arab Public: Iraq, al-Jazeera, and Middle East PoliticsToday (9780231134491) | 1 | Adet |
| Warand Punishment (9780691049441) | 1 | Adet |
| Warin European History (9780199546190) | 1 | Adet |
| Warin Peace: Paramilitary Violence in Europe after the Great War(9780199654918) | 1 | Adet |
| Warin Social Thought: Hobbes to the Present (9780691150840) | 1 | Adet |
| Warfareand Culture in World History (9780814752784) | 1 | Adet |
| Warfarein African History (9780521123976) | 1 | Adet |
| Wavesof War: Nationalism, State Formation, and Ethnic Exclusion in theModern World (9781107025554) | 1 | Adet |
| Weldingand joining of aerospace materials (Woodhead Publishing inMaterials) (9781845695323) | 1 | Adet |
| Weldingand joining of magnesium alloys (Woodhead Publishing in Materials)(9781845696924) | 1 | Adet |
| WeldingDeformation and Residual Stress Prevention (9780123948045) | 1 | Adet |
| WeldingTechnology Fundamentals (9781605252575) | 2 | Adet |
| WesternEducational Experience (9780881338188) | 1 | Adet |
| Whatif They Gave a Crisis and Nobody Came?: Interpreting InternationalCrises (9780275960438) | 1 | Adet |
| Whatis Military History (9780745633916) | 1 | Adet |
| Whatmoney can`t buy: The Moral Limits of Markets (9780374533656) | 1 | Adet |
| WhatSuccessful Math Teachers Do, Grades 6-12: 79 Research-BasedStrategies for the Standards-Based Classroom (9781412916196) | 1 | Adet |
| WhenThings Go Wrong: Foreign Policy Decision Making under AdverseFeedback (9780415895286) | 1 | Adet |
| WhoceJustice? Which Rationality? (9780268019440) | 1 | Adet |
| WhyNations Act: Theoretical Perspectives for Comparative ForeignPolicy Studies (9780803907195) | 1 | Adet |
| WhyNations Fail: The Origins of Power, Prosperity, and Poverty(9780307719218) | 1 | Adet |
| WileyEncyclopedia of Operations Research and Management Science, 8Volume Set (9780470400630) | 1 | Adet |
| WilliamForsythe and the Practice of Choreography: It Starts from AnyPoint (9780415978231) | 1 | Adet |
| WilliamForsythe: Improvisation Technologies: a Tool for the AnalyticalDance Eye (9783775721844) | 1 | Adet |
| WindPower, Revised Edition: Renewable Energy for Home, Farm, andBusiness (9781931498142) | 1 | Adet |
| Womenin Ancient Greece (9780674954731) | 1 | Adet |
| WonderfulThings - Learning with Museum Objects (9781907697449) | 1 | Adet |
| WorldHistory of Warfare (9780803244238) | 1 | Adet |
| WorldingDance (9780230298385) | 1 | Adet |
| Writingson War (9780745652979) | 1 | Adet |
Temel
500 / 1 yıl
- EKAP İhaleleri
- Kurum İhaleleri
- Doğrudan Teminler
- İhale Alarmı - Sınırsız
- İhale Takip - Sınırsız
- Çoklu Rapor Alıcısı
- Mobil Uygulama
Kurumsal
1000 / 1 yıl
- EKAP İhaleleri
- Kurum İhaleleri
- Doğrudan Teminler
- İhale Alarmı - Sınırsız
- İhale Takip - Sınırsız
- Çoklu Rapor Alıcısı
- Mobil Uygulama
- +
- İhale Sonuç İlanları
- İlansız İhale Sonuçları
- Sonuç Alarmları
- KİK Kararları
- Firma ve Rakip Analizleri
- Müşteriler, İş Bitirme Bilgileri, Kırım Oranları
- İhale Öncesi Olası Rakipler
- İdare Analizleri
- Bütçe Tahminleri
- Yüklenicileri
- Yaklaşık Maliyet Analizleri
- Sektör Analizleri
- Sektördeki Öncü Firmalar
- İş Dağılımları
- Pazar Araştırmaları
- Üst Yüklenici ve Alt Yüklenici Araştırması
- Rakip/Firma – İdare – Sektör Özel Takibi
- Haftalık İstihbarat Raporu (PDF)