| İhale No | 2012/137355 |
| Sektör | Matbaa, Yayıncılık Hizmetleri ve Kırtasiye Malzemeleri |
| İdare | Yıldız Teknik Üniversitesi İdari ve Mali İşler Daire Başkanlığı |
| İhale Tipi | Mal Alımı |
| İhale Usulü | Açık İhale |
| İhale İli | İstanbul |
| İşin İli | İstanbul |
| Yayın Tarihi | 25 Ağustos 2015 |
| İhale Tarihi | 19 Ekim 2012 11:00 |
Temel
(KDV Hariç...)
- Kamu İhaleleri
- E-İhaleler
- İlanlı, İlansız Tüm İhaleler
- Doğrudan Temin İhaleleri
- Sınırsız İhale Takibi
- Sınırsız İhale Alarmı
- Günlük İhale Raporu
Kurumsal
(KDV Hariç...)
- Temel Paket Dahil
- AB İhaleleri
- İhale Sonuçları
- Kazanan Firmalar
- İhale Arşivi
- KİK Kararları
- Yasaklı Firma Sorgulama
KİTAP SATIN ALINACAKTIR
Yıldız Te kni k Üniv er sit e si İ da ri Ve M a li İşler Da ire B a şka n lığ ı
Yabancı Dil Kitap Alımı alımı 4734 sayılı Kamu İhale Kanununun 19 uncu maddesine göre açık ihale usulü ile ihale edilecektir. İhaleye ilişkin ayrıntılı bilgiler aşağıda yer almaktadır:
İhale Kayıt Numarası : 2012/137355
1-İda re nin
a) Adresi : Yıldız Teknik Üniversitesi Rektörlüğü Merkez Kampüs Yıldız
Yokuşu Balmumcu 34349 Beşiktaş Istanbul Beşiktaş/Istanbul
b) Telefon ve faks numarası : 2123832141 - 2122612921
c) Elektronik Posta Adresi : imidb@yildiz.edu.tr
ç) İhale dokümanının görülebileceği
internet adresi (varsa) : https://ekap.kik.gov.tr/EKAP/
2-İha le ko n usu ma l ın
a) Niteliği, türü ve miktarı : İhalenin niteliği, türü ve miktarına ilişkin ayrıntılı bilgiye EKAPta (Elektronik Kamu Alımları Platformu) yer alan ihale dokümanı içinde bulunan idari şartnameden ulaşılabilir.
b) Teslim yeri : Yıldız Teknik Üniversitesi Rektörlüğü Kütüphane ve
Dokümantasyon Daire Başkanlığı Yıldız Beşiktaş/Istanbul
c) Teslim tarihi : Sözleşmenin imzalanmasını takip eden 45 gün içerisinde kitaplar koliler içersinde paket listeleri ile birlikte yeni, orjinal ve hiç kullanılmamış olarak imza karşılığı Kütüphane ve Dökümantasyon Daire Başkanlığına teslim edilecektir.
3- İha lenin
Yıldız Teknik Üniversitesi Rektörlüğü Merkez Kampüs Rektörlük
a) Yapılacağı yer : Binası İdari ve Mali İşler Daire Başkanlığı Satınalma Müdürlüğü
Yıldız Yokuşu Balmumcu 34349 Beşiktaş/Istanbul
b) Tarihi ve saati : 19.10.2012 - 11:00
4. İhaleye katılabilme şartları ve istenilen belgeler ile yeterlik değerlendirmesinde uygulanacak kriterler:
4.1. İhaleye katılma şartları ve istenilen belgeler:
4.1.1. Mevzuatı gereği kayıtlı olduğu Ticaret ve/veya Sanayi Odası ya da ilgili Esnaf ve Sanatkarlar Odası
belgesi;
4.1.1.1. Gerçek kişi olması halinde, ilk ilan veya ihale tarihinin içinde bulunduğu yılda alınmış, ilgisine göre
Ticaret ve/veya Sanayi Odasına ya da ilgili Esnaf ve Sanatkarlar Odasına kayıtlı olduğunu gösterir belge,
4.1.1.2. Tüzel kişi olması halinde, ilgili mevzuatı gereği kayıtlı bulunduğu Ticaret ve/veya Sanayi Odasından, ilk ilan veya ihale tarihinin içinde bulunduğu yılda alınmış, tüzel kişiliğin odaya kayıtlı olduğunu gösterir belge,
4.1.2. Teklif vermeye yetkili olduğunu gösteren imza beyannamesi veya imza sirküleri;
4.1.2.1. Gerçek kişi olması halinde, noter tasdikli imza beyannamesi,
4.1.2.2. Tüzel kişi olması halinde, ilgisine göre tüzel kişiliğin ortakları, üyeleri veya kurucuları ile tüzel kişiliğin yönetimindeki görevlileri belirten son durumu gösterir Ticaret Sicil Gazetesi, bu bilgilerin tamamının bir Ticaret Sicil Gazetesinde bulunmaması halinde, bu bilgilerin tümünü göstermek üzere ilgili Ticaret Sicil Gazeteleri veya bu hususları gösteren belgeler ile tüzel kişiliğin noter tasdikli imza sirküleri,
4.1.3. Şekli ve içeriği İdari Şartnamede belirlenen teklif mektubu.
4.1.4. Şekli ve içeriği İdari Şartnamede belirlenen geçici teminat.
4.1.5 İhale konusu alımın tamamı veya bir kısmı alt yüklenicilere yaptırılamaz.
4.2. Ekonomik ve mali yeterliğe ilişkin belgeler ve bu belgelerin taşıması gereken kriterler:
İdare tarafından ekonomik ve mali yeterliğe ilişkin kriter belirtilmemiştir.
4.3. Mesleki ve Teknik yeterliğe ilişkin belgeler ve bu belgelerin taşıması gereken kriterler:
İdare tarafından mesleki ve teknik yeterliğe ilişkin kriter belirtilmemiştir.
5.Ekonomik açıdan en avantajlı teklif sadece fiyat esasına göre belirlenecektir.
6. İhale yerli ve yabancı tüm isteklilere açıktır.
7. İhale dokümanının görülmesi ve satın alınması:
7.1. İhale dokümanı, idarenin adresinde görülebilir ve 50 TRY (Türk Lirası) karşılığı Yıldız Teknik Üniversitesi Rektörlüğü Merkez Kampus Rektörlük Binası İdari ve Mali İşler Daire Başkanlığı Satınalma Müdürlüğü Yıldız Yokuşu Balmumcu 34349 Beşiktaş/Istanbul adresinden satın alınabilir.
7.2. İhaleye teklif verecek olanların ihale dokümanını satın almaları veya EKAP üzerinden e-imza kullanarak indirmeleri zorunludur.
8. Teklifler, ihale tarih ve saatine kadar Yıldız Teknik Üniversitesi Rektörlüğü Merkez Kampus Rektörlük Binası İdari ve Mali İşler Daire Başkanlığı Satınalma Müdürlüğü Yıldız Yokuşu Balmumcu 34349 Beşiktaş/Istanbul adresine elden teslim edilebileceği gibi, aynı adrese iadeli taahhütlü posta vasıtasıyla da gönderilebilir.
9. İstekliler tekliflerini, mal kalem-kalemleri için teklif birim fiyatlar üzerinden vereceklerdir. İhale sonucu, üzerine ihale yapılan istekliyle her bir mal kalemi miktarı ile bu mal kalemleri için teklif edilen birim fiyatların
çarpımı sonucu bulunan toplam bedel üzerinden birim fiyat sözleşme imzalanacaktır. Bu ihalede, kısmı teklif verilebilir.
10. İstekliler teklif ettikleri bedelin %3ünden az olmamak üzere kendi belirleyecekleri tutarda geçici teminat
vereceklerdir.
11. Verilen tekliflerin geçerlilik süresi, ihale tarihinden itibaren 60 (altmış) takvim günüdür.
12. Konsorsiyum olarak ihaleye teklif verilemez.
| Cetvel Adı | Miktar | Birim |
|---|---|---|
| 1000puzzles, paradoxes, illusions & games (0761118268,9780761118268) | 1 | Adet |
| 44Letters From the Liquid Modern World-Understanding our Time(978-0745650579) | 1 | Adet |
| ABeginner`s Guide to Discrete Mathematics | 1 | Adet |
| ABook of Abstract Algebra: Second Edition (978-0486474175) | 1 | Adet |
| AChemical Study of Oils and Fats of Animal Origin(978-2-9533244-0-2) | 1 | Adet |
| ACompanion to Heidegger (978-1405163668) | 1 | Adet |
| AConcrete Approach to Abstract Algebra: From the Integers to theInsolvability of the Quintic (978-0123749413) | 1 | Adet |
| ACourse in Combinatorics | 1 | Adet |
| Acourse in enumeration | 1 | Adet |
| AFirst Course in Discrete Mathematics (Springer UndergraduateMathematics Series) (978-1852332365 /// 1852332360) | 1 | Adet |
| AFirst Course in the Theory of Linear Statistical Models(534916457) | 1 | Adet |
| AFirst Step to Mathematical Olympiad Problems | 1 | Adet |
| AFramework for K-12 Science Education: Practices, CrosscuttingConcepts, and Core Ideas (ISBN-10: 0-309-21742-3 ISBN-13:978-0-309-21742-2) | 2 | Adet |
| AGeography of Heritage (978-0340677780) | 1 | Adet |
| AGeometric Approach to Differential Forms ( 978-0817683030 ) | 1 | Adet |
| AHandbook of Sustainable Building Design and Engineering (SonBaskı/978-1844075966) | 1 | Adet |
| AHistory of Military Thought (978-0199247622) | 1 | Adet |
| AHistory of Photography (-10: 521344077) | 1 | Adet |
| AHistory of Photography: From 1839 to the Present; The GeorgeEastman House Collection (ISBN-10:3822847771) | 2 | Adet |
| AHistory of Photography: The Musée d`Orsay Collection 1839-1925 ( ISBN-10:208030092X) | 1 | Adet |
| AHistory of Western Music | 2 | Adet |
| ALeftist Ontology: Beyond Relativism and Identity Politics (978-0-8166-5030-9 ) | 1 | Adet |
| AMathematical Introduction to Robotic Manipulation (978-1439847688) | 1 | Adet |
| AMilitary History of the Ottomans: From Osman to Atatürk(978-0275988760) | 1 | Adet |
| Aprimer in density functional theory | 1 | Adet |
| APrimer on Pontryagin`s Principle in Optimal Control | 1 | Adet |
| AResearch Companion to Principles and Standards for SchoolMathematics (ISBN-10: 0873535375 ISBN-13: 978-0873535373) | 1 | Adet |
| Asoftware-defined GPS and Galileo receiver: | 1 | Adet |
| AVector Space Approach to Geometry (Dover Books on Mathematics)[Paperback] ( 978-0486404523 ) | 1 | Adet |
| ABSTRACTALGEBRA (978-1577664437) | 1 | Adet |
| AbstractAlgebra (Graduate Texts in Mathematics) (978-1441924506) | 1 | Adet |
| AbstractAlgebra: An Introduction to Groups, Rings and Fields (978-9814335645) | 1 | Adet |
| AbstractAlgebra: Theory and Applications (978-0982406250) | 1 | Adet |
| AcademicWriting; A Handbook for International Students (3rd Edition) ((ISBN-10:0415595819| ISBN-13:978-0415595810)) | 2 | Adet |
| Academies,Museums and Canons of Art (978-0300077414) | 1 | Adet |
| Acousticsof ducts and mufflers with application to exhaust and ventilationsystem design (978-0-471-84738-0) | 1 | Adet |
| ActionResearch: A Guide for the Teacher Researcher | 2 | Adet |
| Actsof Resistance-Against the new Myths of our time (978-0745622187) | 1 | Adet |
| AdditiveCombinatorics | 1 | Adet |
| Adorno,A Biography | 1 | Adet |
| AdvancedControl of Aircraft, Spacecraft and Rockets (978-0470745632) | 1 | Adet |
| Advancedlinear algebra (///// 978-0-387-72828-5) | 1 | Adet |
| AdvancedMethods of Biomedical Signal Processing (978-0470422144) | 1 | Adet |
| AdvancedMicrosystems for Automotive Applications 2010: Smart Systems forGreen Cars and Safe Mobility | 1 | Adet |
| AdvancedPower System Analysis and Dynamics (1906574871, 978-1906574871) | 1 | Adet |
| AdvancedWireless Networks: Congitive, Cooperative and Opportunistic 4GTechnology (0-470-74250-X) | 1 | Adet |
| Advancesin Geo-Spatial Information Science (9780415620932 ) | 1 | Adet |
| Advancesin Nature of Science Research: Concepts and Methodologies (978-9400724563) | 2 | Adet |
| Advancesin Spatial Data Handling and GIS: 14th International Symposium onSpatial Data Handling Series: Lecture Notes in Geoinformation andCartograp (978-3-642-25925-8) | 1 | Adet |
| AdvertisingResearch: Theory & Practice, 2/E (132128322) | 1 | Adet |
| Afterwards:Contemporary Photography Confronting the Past (ISBN-10:500543984) | 1 | Adet |
| Agent-BasedModels of Geographical Systems (978-90-481-8926-7) | 1 | Adet |
| Airborneand Terrestrial Laser Scanning (ISBN-10: 1439827982 ISBN-13:978-1439827987) | 1 | Adet |
| AlbertEinstein`s Special Theory of Relativity: Emergence (1905) andEarly Interpretation (1905-1911) (978-0387948706 ) | 1 | Adet |
| Algebra(2nd Edition) (978-0132413770) | 1 | Adet |
| Algebra(Dover Books on Mathematics) (978-0486439471) | 1 | Adet |
| AlgebraicCombinatorics on Words | 1 | Adet |
| AlgebraicCurves over a Finite Field (978-0-6910-9679-7) | 1 | Adet |
| Algebraicgeometric codes: basic notions (978-0-8218-4306-2) | 1 | Adet |
| Allthe Missing Souls A Personal History of the War Crimes Tribunals | 1 | Adet |
| AllTogether Now: Museums and Online Collaborative Learning(978-1933253619) | 1 | Adet |
| AlternativeFuels: Emissions, Economics, and Performance (978-0-7680-3609-1) | 1 | Adet |
| Ambigutiesof Domination: Politics, Rhetoric and Symbols in ContemporrarySyria | 1 | Adet |
| America`sArmy: Making the All-Volunteer Force (978-0674035362) | 1 | Adet |
| AnAnthropology of Images: Picture, Medium, Body (ISBN-10:691145008) | 1 | Adet |
| AnIntroduction to Advanced Quantum Physics (978-0-470-68676-8) | 1 | Adet |
| AnIntroduction to Computational Fluid Mechanics by Example(978-0-470-10226-8) | 1 | Adet |
| AnIntroduction To Differential Geometry - With The Use Of TensorCalculus (978-1443722933 ) | 1 | Adet |
| AnIntroduction to Differential Geometry (Dover Books on Mathematics) ( 978-0486486185 ) | 1 | Adet |
| AnIntroduction to Diophantine Equations (978-0-8176-4548-9) | 1 | Adet |
| AnIntroduction to Engine Testing and Development (978-0-7680-2099-1) | 1 | Adet |
| AnIntroduction to Geographical Information Systems (9780273722595) | 1 | Adet |
| AnIntroduction to Lorentz Surfaces (De Gruyter Expositions inMathematics) (978-3110143331 ) | 1 | Adet |
| AnIntroduction to Manifolds (Universitext) ( 978-1441973993 ) | 1 | Adet |
| AnIntroduction to Political Philosophy | 1 | Adet |
| AnIntroduction to Qualitative Research (978-1847873248) | 1 | Adet |
| AnIntroduction to Sociology (978-0745650081) | 1 | Adet |
| AnInvitation to Discrete Mathematics (978-0198570424 /// 0198570422) | 1 | Adet |
| AnInvitation to Social Theory (978-0745642093) | 1 | Adet |
| Anintroduction to quantum computing, (978-0198570493 ) | 1 | Adet |
| Analyticcombinatorics | 1 | Adet |
| AnalyticGeometry ( 978-0201134841 ) | 1 | Adet |
| AnalyticGeometry [Hardcover] (978-0534948542 ) | 1 | Adet |
| AnalyticalGeometry of Three Dimensions (Dover Books on Mathematics) (978-0486453132 ) | 1 | Adet |
| AndroidApps with App Inventor The Fast and Easy Way to Build Android Apps(ISBN13: 9780321812704 ISBN10: 0321812700) | 1 | Adet |
| Androidfor Programmers An App-Driven Approach (ISBN13: 9780132121361ISBN10: 0132121360) | 1 | Adet |
| APPLIEDCRYPTOGRAPHY | 1 | Adet |
| AppliedIntermediate Macroeconomics (978-0521763882 ) | 1 | Adet |
| AppliedTheatre: International Case Studies and Challenges for Practice | 1 | Adet |
| Archaeologyand Heritage (978-0826458957) | 1 | Adet |
| Armsand Men (978-9004206687) | 1 | Adet |
| Artand the Power of Placement (978-1580931489) | 1 | Adet |
| ArtApart (978-0719039188) | 1 | Adet |
| Artfor the Nation (978-0719054532) | 1 | Adet |
| AtMemory`s Edge (978-0300094138) | 1 | Adet |
| Ausgleichungsrechnung:Statistische Auswertemethoden: Uberarbeitete Und ErweiterteAuflage (978-3110190557) | 1 | Adet |
| Automatictext processing: the transformation, analysis, and retrieval ofinformation by computer (0201122278 9780201122275) | 1 | Adet |
| AutomotiveEngineering: Powertrain, Chassis System and Vehicle Body | 1 | Adet |
| AutomotiveFuels Reference Book-Second Edition (978-1-56091-589-8) | 1 | Adet |
| AutomotiveSoftware Engineering (978-0-7680-1490-7) | 1 | Adet |
| Badiouand Politics (978-0822350767) | 1 | Adet |
| BadiouA Subject to Truth (978-0-8166-3461-3 ) | 1 | Adet |
| Bailey`sIndustrial Oil and Fat Products. Volume 5 (978-0-471-38548-6) | 1 | Adet |
| Bailey`sIndustrial Oil and Fat Products. Volume2 (978-0-471-38551-6) | 1 | Adet |
| Bailey`sIndustrial Oil and Fat Products. Volume4 (978-0-471-38549-3) | 1 | Adet |
| Bailey`sIndustrial Oil and Fat Products. Volume6 (978-0-471-38546-2) | 1 | Adet |
| Basicsof Holography (978-0521002004) | 3 | Adet |
| Beautyand the Beasts (978-0874749571) | 1 | Adet |
| Behindthe Scenes at the Science Museum (978-1859735718) | 1 | Adet |
| Beyondthe Prado (978-0853235354) | 1 | Adet |
| Beyondthe Turnstile: Making the Case for Museums and Sustainable Values (978-0759112216) | 1 | Adet |
| BiobasedSurfactants and Detergents: Synthesis, Properties, andApplications (978-1-893997-67-7) | 1 | Adet |
| Biocatalysisand Bioenergy (978-0-470-13404-7) | 1 | Adet |
| Biocatalysisand Biotechnology for Functional Foods and Industrial Products(0-849392-82-9) | 1 | Adet |
| BiologyTeacher`s Survival Guide: Tips, Techniques & Materials forSuccess in the Classroom (J-B Ed: Survival Guides) | 1 | Adet |
| Biomedicalsignal and image processing (978-0849320996) | 1 | Adet |
| BioprocessEngineering Principles (978-0122208560) | 10 | Adet |
| Biosignaland Medical Image Processing (978-1420062304) | 1 | Adet |
| BirthrightLottery: Citizenship and Global İneqaulity | 1 | Adet |
| BleachingAnd Purifying Off Fats and Oils 2nd Edition | 1 | Adet |
| BoilerOperations Questions and Answers, 2nd Edition (0-07-135675-4) | 1 | Adet |
| BoilerOperator`s Handbook (881734349) | 1 | Adet |
| BoschAutomotive Handbook, 8th Edition (978-0-7680-4851-3) | 1 | Adet |
| BoundaryLayer Theory (3-540-66270-7) | 1 | Adet |
| BoundaryValue Problems of Heat Conduction (-10: 0486495159 -13:978-0486495156) | 1 | Adet |
| Breakwaters,Coastal Structures and Coastlines, (ISBN-10: 0727730428 | ISBN-13:978-0727730428) | 1 | Adet |
| Brogdon`sForensic Radiology (978-1420075625) | 1 | Adet |
| Buildinga GIS: System Architecture Design Strategies for Managers (9781589483071) | 1 | Adet |
| BusinessEthics Ethical Decision Making and Cases (978-1111825164) | 1 | Adet |
| Businessto Business Marketing | 1 | Adet |
| CambridgeIllustrated History of Germany (978-0521453417) | 1 | Adet |
| CentralAsia in World History (978-0195159479) | 1 | Adet |
| Chemistryand technology of lubricants | 1 | Adet |
| Chemistryof Art: Learning Science through the Fine Arts (ISBN-10:0123813719) | 1 | Adet |
| ChevroletVolt--Development Story of the Pioneering Electrified Vehicle(978-0-7680-4765-3) | 1 | Adet |
| Childdevelopment (97802055070610205507069 ) | 2 | Adet |
| Children`smathematics: cognitively guided instruction (0325001375,9780325001371) | 1 | Adet |
| Chinaand the Great War (978-0521283236) | 1 | Adet |
| Citiesand Forms: On Sustainable Urbanism (9782705681111) | 1 | Adet |
| Citizens:A Chronicle of the French Revolution (978-0679726104) | 1 | Adet |
| Citizenshipand Identity in Turkey: From Ataturk`s Republic to the Present Day | 1 | Adet |
| Citizenshipand Social Movements (978-1848133891) | 1 | Adet |
| CityTrenches: Urban Politics and Patterning of Class in the UnitesStates | 1 | Adet |
| ClassicalFeedback Control: With MATLAB® and Simulink®, Second Edition(978-1439860175) | 1 | Adet |
| ClassicalGeometries in Modern Contexts: Geometry of Real Inner ProductSpaces (978-3764373719 ) | 1 | Adet |
| Classicsof Political and Moral Philosophy | 2 | Adet |
| CoastalEngineering: Processes, Theory and Design Pracice | 1 | Adet |
| CoastalZone Management: Progress and Effectiveness (EnvironmentalScience, Engineering and Technology) (-10: 161209919X | -13:978-1612099194) | 1 | Adet |
| Codesand curves (0-8212-2628-X) | 1 | Adet |
| CodesOn Euclidean Spaces (0 444 50329 3) | 1 | Adet |
| CODINGTHEORY (0-521-84868-7) | 1 | Adet |
| CodingTheory and Applications (978-3-540-87447-8) | 1 | Adet |
| CodingTheory and Cryptography: From Enigma and Geheimschreiber toQuantum Theory (978-3540663362 ) | 1 | Adet |
| CodingTheory and Quantum Computing (Contemporary Mathematics)(978-0821836002 ) | 1 | Adet |
| Codingtheory: algorithms, architectures, and applications(978-0-470-02861-2) | 1 | Adet |
| CognitiveCapitalism, Education and Digital Labor (978-1-4331-0981-2 ) | 1 | Adet |
| CollateralDamage-Social Inequalities in a Global Age (978-0745652955) | 1 | Adet |
| Collectingthe New | 1 | Adet |
| Colonialismand Postcolonialism (978-0415350648) | 1 | Adet |
| CombinatorialProblems in Mathematical Competitions (/////9812839496) | 1 | Adet |
| Combinatoricsand Graph Theory | 1 | Adet |
| Combinatoricsand Probability | 1 | Adet |
| Combinatorics:A Guided Tour (/////9780883857625 ) | 1 | Adet |
| Combustion(978-1894078559) | 1 | Adet |
| Combustionin piston engines: technology, evolution, diagnosis, and control | 1 | Adet |
| Combustiontheory: the fundamental theory of chemically reacting flow systems | 1 | Adet |
| CommandCulture: Officer Education in the US Army and the German ArmedForces (978-1574413038) | 1 | Adet |
| Communicationand Organizational Culture | 1 | Adet |
| CommunicationSystems | 2 | Adet |
| CommunicationSystems Engineering | 2 | Adet |
| Communitarianismand Individualism (978-0198780281 ) | 1 | Adet |
| ComputationalOptimization of Internal Combustion Engines (ISBN978-0-85729-618-4) | 1 | Adet |
| Computer-AssistedAnalysis of Mixtures and Applications: Meta Analysis, DiseaseMapping, and Others (978-1584881797) | 1 | Adet |
| Computer-BasedDiagnostics and Systematic Analysis of Knowledge(978-1-4419-4579-2) | 1 | Adet |
| Concertofor Piano and Orchestra (ED 7746) | 1 | Adet |
| ConciseHistory of Western Music (0-393-97168-6) | 2 | Adet |
| Concrete(978-0130646323) | 1 | Adet |
| Condensedmatter in a nutshell (978-0691140162) | 1 | Adet |
| ConformalMapping, Methods and Application (048643236X, 9780486432366) | 1 | Adet |
| ConsumerBehavior, 10/E | 1 | Adet |
| ConsumerBehavior, 9/E | 1 | Adet |
| ConsumingLife (978-0745640020) | 1 | Adet |
| ContemporaryDebates in Moral Theory | 1 | Adet |
| ContemporaryDebates in Political Philosophy (140513321X) | 1 | Adet |
| ContemporaryDebates in Social Philosophy | 1 | Adet |
| ContemporarySecurity Studies (978-0199548859) | 1 | Adet |
| ContentAnalysis: An Introduction to Its Methodology (978-0761915454) | 1 | Adet |
| ContestingHuman Remains in Museum Collections (978-0415879606) | 1 | Adet |
| Context-Dependencein the Analysis of Linguistic Meaning | 1 | Adet |
| ControlSystems Engineering (Sixth Edition) | 1 | Adet |
| ControlSystems Safety Evaluation and Reliability (1934394807) | 1 | Adet |
| Conversationswith Zygmunt Bauman (978-0745626659) | 1 | Adet |
| CooperativeControl Design: A Systematic, Passivity-Based Approach(978-1-4614-0013-4) | 1 | Adet |
| CooperativeControl of Dynamical Systems: Applications to Autonomous Vehicles(978-1848823242) | 1 | Adet |
| Cooperativecommunications: hardware, channel & PHY | 1 | Adet |
| Cooperativewirelesscommunications | 1 | Adet |
| CorporateCulture (978-0470932193 ) | 1 | Adet |
| CorporateReputation (978-0-566-09205-3) | 1 | Adet |
| CorporateSocial Responsibility, Gocernance and Corporate Reputation(981-4335-17-7) | 1 | Adet |
| CORSand OPUS for Engineers: Tools for Surveying and MappingApplications (978-0784411643) | 3 | Adet |
| CosmopoliticalClaims:Turkish-German literatures from Nadolny to Pamuk(978-1587295843) | 2 | Adet |
| COUNTERPOINTIN COMPOSITION (978-0231070393 ) | 1 | Adet |
| COUNTERPOINT,The Polyphonic Vocal Style of the Sixteenth Century (0-486-27036-X(pbk.)) | 1 | Adet |
| Countriesand Concepts: Politics, Geography, Culture (12th Edition)(978-0205854653) | 2 | Adet |
| Creatingthe Museum of Scotland (978-1901663112) | 1 | Adet |
| CreativeCommunity Builder`s Handbook: How to Transform Communities UsingLocal Assets, Arts, and Culture | 1 | Adet |
| CriticalHeidegger (978-0415129503) | 1 | Adet |
| CriticalSocial Theory: Culture, History and the challenge of Difference(978-0415990417) | 1 | Adet |
| CRYPTOLOGYUNLOCKED (0470060646 //// 978-0470060643) | 1 | Adet |
| Culturein a Liquid Modern World (978-0745653556) | 1 | Adet |
| Culturein the Age of Three Worlds | 1 | Adet |
| Cultureon Display (978-0335206575) | 1 | Adet |
| CyberSecurity Essentials (978-1-4398-5123-4) | 1 | Adet |
| Cyprus:The Post-Imperial Constitution | 1 | Adet |
| Danceof the Furies: Europe and the Outbreak of World War I(978-0674049543) | 1 | Adet |
| DarkNavy: The Italian Regia Marina and the Armistice of 8 September1943 (978-1934840917) | 1 | Adet |
| Darwin`sCamera: Art and Photography in the Theory of Evolution(ISBN-10:195150317) | 1 | Adet |
| DASLIED FON DER ERDE in Full Score (0-486-25657-X) | 2 | Adet |
| Dataand Text Mining: A Business Applications Approach | 1 | Adet |
| Dealingwith Genetically Modified Crops (1-893997-22-7) | 1 | Adet |
| DeepFrying: Chemistry, Nutrition and Practical Applications, 2ndEdition (978-1-893997-92-9) | 1 | Adet |
| Democratizationand the Politics of Constitution-making turkey (978 963 977 630 2) | 1 | Adet |
| Dentalbiomaterials: Imaging, testing and modelling (ISBN 1 84569 296 9ISBN-13: 978 1 84569 296 4) | 1 | Adet |
| Designof Smart Power Grid Renewable Energy Systems | 2 | Adet |
| DIGITALCOMMUNICATIONS (0-273-71830-4) | 1 | Adet |
| DieKunst der Fuge (Teilband 1: Ausgabe nach dem Originaldruck -Teilband 2: Ausgabe nach den autographen Quellen). (9790010000000) | 1 | Adet |
| DieselEmissions and Their Control (978-0-7680-0674-2) | 1 | Adet |
| DifferentialForms and Applications (Universitext) ( 978-3540576181 ) | 1 | Adet |
| DifferentialGeometry (Dover Books on Mathematics) (978-0486667218) | 1 | Adet |
| DifferentialGeometry (Dover Books on Mathematics) (978-0486634333 ) | 1 | Adet |
| DifferentialGeometry of Curves and Surfaces (978-1568814568 ) | 1 | Adet |
| DifferentialGeometry of Lightlike Submanifolds (Frontiers in Mathematics)[Paperback] (978-3034602501 ) | 1 | Adet |
| DifferentialGeometry of Manifolds ( 978-1568814575 ) | 1 | Adet |
| DifferentialGeometry: Bundles, Connections, Metrics and Curvature (OxfordGraduate Texts in Mathematics, Vol. 23) [Paperback] (978-0199605873 ) | 1 | Adet |
| DifferentialGeometry: Curves - Surfaces - Manifolds, Second Edition(978-0821839881 ) | 1 | Adet |
| DifferentialManifolds (Dover Books on Mathematics) (978-0486462448 ) | 1 | Adet |
| DiscreteEvent System Simulation (978-0136062127) | 3 | Adet |
| DiscreteMathematics (978-0821841518 /// 0821841513) | 1 | Adet |
| DiscreteMathematics with Combinatorics (2nd Edition) (978-0130457912 ///0130457914) | 1 | Adet |
| DreiSonaten fur Viola da gamba und Cembalo BWV 1027-1029-Kammermusikwerke, Band 4 (9790010000000) | 1 | Adet |
| DriverBehaviour and Training, Vol. 2 (Human Factors in Road and RailTransport) (-10: 0754644308 -13: 978-0754644309) | 1 | Adet |
| EarlyChildhood Environment Rating Scale [Spiral-bound] (9780807745496) | 1 | Adet |
| Electrical& Mechanical Component Reliability Handbook (972723463) | 1 | Adet |
| ElectronicStructure: Basic Theory and Practical Methods (978-0521782852) | 1 | Adet |
| Elementaryand Middle School Mathematics: Texas Edition | 1 | Adet |
| ElementaryDifferential Geometry (978-0120887354 ) | 1 | Adet |
| ElementaryDifferential Geometry ( 978-0521721493 ) | 1 | Adet |
| ElementaryLinear Algebra ( 978-0470458211 ) | 1 | Adet |
| Elementsof Modern Algebra (978-0495561361 ) | 1 | Adet |
| EmissionsFrom Two-Stroke Engines (978-0-7680-0215-7) | 1 | Adet |
| Empire,Islam, and Politics of Difference (978-9004211315) | 1 | Adet |
| EngineCombustion: Pressure Measurement and Analysis (978-0-7680-1963-6) | 1 | Adet |
| Engineemissions: pollutant formation and advances in control technology(9781840000000) | 1 | Adet |
| Entanglement-AssistedQuantum Error-Correcting Codes (978-90-481-2810-5_14 ) | 1 | Adet |
| EnzymeTechnologies: Metagenomics, Evolution, Biocatalysis andBiosynthesis (Chemical Biology of Enzymes for Biotechnology andPharmaceutical (1616686820) | 1 | Adet |
| Epigenetics (879698756) | 1 | Adet |
| Essentialsof Discrete Mathematics (Jones and Bartlett Publishers Series inMathematics) (978-0763748920 /// 0763748927) | 1 | Adet |
| ETCSfor Engineers (978-3-7771-0416-4) | 1 | Adet |
| Euclideanand Non-Euclidean Geometry: An Analytic Approach [Paperback] (978-0521276351 ) | 1 | Adet |
| EurocentrismA Critical Realist and Marxian Critique of Civil Society(978-0-415-56510-3) | 1 | Adet |
| Experienceor Interpretation (978-0500282168) | 1 | Adet |
| Fanon-Thepostcolonial Imagination (978-0745622613) | 1 | Adet |
| Farewellto Marx: An Outline and Appraisal of His Theories (Pelican)(978-0140223651) | 1 | Adet |
| Feedbackin Second Language Writing Paperback ((-13: 9780521672580 | -10:0521672589)) | 2 | Adet |
| FinalElements & the IEC 61508 and IEC 61511 Functional SafetyStandards (097272348X) | 1 | Adet |
| FindingCommon Ground (978-9004191822) | 1 | Adet |
| FiniteFields and Applications (978-0821844182) | 1 | Adet |
| FirstPhotographs: William Henry Fox Talbot and the Birth of Photography (-10:1576871533) | 1 | Adet |
| Foodand War in Twentieth-Century Europe (978-1409417705) | 1 | Adet |
| Freedomand Karl Jasper`s Philosophy (978-0300026290) | 1 | Adet |
| FunctionalSafety - An IEC 61508 SIL 3 Compliant Development Process(1934977012) | 1 | Adet |
| Fundamentalsand technology of combustion (9780080441061) | 1 | Adet |
| Fundamentalsof Automobile Body Structure Design (978-0-7680-2169-1) | 1 | Adet |
| Fundamentalsof Differential Geometry (Graduate Texts in Mathematics)(978-0387985930 ) | 1 | Adet |
| Fundamentalsof the Physics of Solids Vol. I (978-3-540-72599-2 ) | 1 | Adet |
| Fundamentalsof Transportation Systems Analysis: Basic Concepts (ISBN-10:0262632896 ISBN-13: 978-0262632898) | 1 | Adet |
| GamesPeople Play: The Basic Handbook of Transactional Analysis(978-0345410030) | 1 | Adet |
| Genderand Social Protection in the Developing World (978-1780320427) | 1 | Adet |
| Genetics(-10: 1449635962) | 2 | Adet |
| GeometricalPhysics in Minkowski Spacetime (Springer Monographs inMathematics) ( 978-1849968669 ) | 1 | Adet |
| Geometryof Lightlike Submanifolds.: Lightlike Hypersurfaces and IsotropicSubmanifolds (978-3847303145 ) | 1 | Adet |
| Geometryof Minkowski Space-Time (SpringerBriefs in Physics) [Paperback] (978-3642179761 ) | 1 | Adet |
| GeospatialData Harmonisation: Methods, Tools and Benefits (9780415691260 ) | 1 | Adet |
| GeospatialVision 2: Proceedings of the GeoCart` 2010 conference Series:Lecture Notes in Geoinformation and Cartography(978-3-642-12288-0) | 1 | Adet |
| GlobalLorentzian Geometry (Chapman & Hall/CRC Pure and AppliedMathematics) ( 978-0824793241 ) | 1 | Adet |
| GlobalPerspectives on Orhan Pamuk:Existantialism &Politics-Literatures and Cultures of the Islamic World(978-0230114111.) | 1 | Adet |
| GlobalPolitics (978-1403989826) | 2 | Adet |
| GPSHandbook for Professional GPS Users ( 978-9081275415) | 1 | Adet |
| GraphTheory (////9789814271127 ) | 1 | Adet |
| Greenand Ecological Technologies for Urban Planning: Creating SmartCities (ISBN13: 9781613504536, ISBN10: 1613504535, EISBN13:9781613504543) | 1 | Adet |
| GreenUrbanism : Learning From European Cities (978-1-4175-4380-9) | 1 | Adet |
| Guardiansof the Republic: A History of the Noncommissioned Officer Coprs ofthe United States Army (978-0449909232) | 1 | Adet |
| GuerrillaWarfare & Espionage in Greece, 1940-1944 (978-0918618504) | 1 | Adet |
| Handbookof Combinatorial Designs (/////978-0849389481) | 1 | Adet |
| Handbookof Data Visualization (ISBN 978-3-540-33036-3) | 1 | Adet |
| Handbookof Offshore Surveying Volume:1 (978-90-816591-1-6) | 1 | Adet |
| Handbookof Offshore Surveying Volume:2 (978-90-816591-2-3) | 1 | Adet |
| Handbookof Offshore Surveying Volume:3 (978-90-816591-3-0) | 1 | Adet |
| HeavyVehicle Mechanics (9780074520819) | 1 | Adet |
| HeavyVehicle Technology (9780748702756) | 1 | Adet |
| HighVoltage Engineering (8122418597, 9788122418590) | 1 | Adet |
| HighVoltage Measurements and Calibration: Conference Proceedings(0700806121, 9780700806126) | 1 | Adet |
| Howto Read Paintings (978-0550101228) | 1 | Adet |
| Hybrid-PoweredVehicles, Second Edition (978-0-7680-3497-4) | 1 | Adet |
| IC ENGINES (9780070648173) | 1 | Adet |
| IEC61499 Function Blocks for Embedded and Distributed Control SystemsDesign (0979234301) | 1 | Adet |
| Ignitethe Power of Art: Advancing Visitor Engagement in Museums(978-1933253631) | 1 | Adet |
| Impactof rail Infrastructure charging systems implemented in Europe onthe competitiveness of hogh speed services (978-3-7771-0405-8) | 1 | Adet |
| IncompressibleAerodynamics (978-0486654652) | 1 | Adet |
| Infant/ToddlerEnvironment Rating Scale [Spiral-bound] (978-0807746400 ) | 1 | Adet |
| Informationtheory, coding and cryptography (978-0071231336) | 1 | Adet |
| InternalCombustion Engine Handbook (978-0-7680-1139-5) | 1 | Adet |
| Introductionto Analytical Geometry ( 978-0521116190) | 1 | Adet |
| Introductionto Chemical Engineering Thermodynamics . 7th.ed | 5 | Adet |
| Introductionto Coding theory (0521845041, 9780521845045) | 1 | Adet |
| IntroductionTo Phonons And Electrons (978-9812384614) | 1 | Adet |
| Introductionto Smooth Manifolds [Hardcover] (978-0387954950 ) | 1 | Adet |
| JacquesLacan (231-101465) | 1 | Adet |
| JudicialPractice (978-9004179349) | 1 | Adet |
| Kammermusik,Band 2 (9790010000000) | 1 | Adet |
| Kammermusik,Band 3 (9790006461868) | 1 | Adet |
| Kanons/ Musikalisches Opfer (Kanons BWV 1072-1078 und BWV deest/Musikalisches Opfer BWV 1079 (9790010000000) | 1 | Adet |
| Kanons/ Musikalisches Opfer (Urtext der Neuen Mozart-Ausgabe).(9790010000000) | 1 | Adet |
| Kinematicsand Linkage Design ( 978-0881332728 ) | 1 | Adet |
| Laquestion Macédonienne de 1944 à nos jours - Communisne etnationalisme dans les Balkans (978-2-296-12676-3) | 1 | Adet |
| Learningand Teaching Geometry, (087353235X, 9780873532358) | 1 | Adet |
| Learningat the Museum Frontiers: Identity, Race & Power (978-0754646914) | 1 | Adet |
| LessThan Nothing: Hegel and the Shadow of Dialectical Materialism (978-1844678976) | 1 | Adet |
| Lessonslearned from research (087353526X, 9780873535267) | 1 | Adet |
| LettingGo? Sharing Authority in a User-Generated World (978-1933253636) | 1 | Adet |
| LightlikeSubmanifolds of Semi-Riemannian Manifolds and Applications(Mathematics and Its Applications (978-9048146789 ) | 1 | Adet |
| LinearAlgebra (978-1441930811 ) | 1 | Adet |
| LinearAlgebra (Dover Books onMathematics) (978-0486635187 ) | 1 | Adet |
| LinearAlgebra and Its Applications ( 978-0030105678 ) | 1 | Adet |
| LinearAlgebra and Its Applications (4th Edition) (978-0321385178 ) | 1 | Adet |
| LinearAlgebra: A Geometric Approach ( 978-0716743378 ) | 1 | Adet |
| LinearAlgebra: A Modern Introduction ( 978-0538735452 ) | 1 | Adet |
| Listeningin on Museum Conversations (978-0759104426) | 1 | Adet |
| Machinesand Mechanisms: Applied Kinematic Analysis (3rd Edition) (978-0131837768 ) | 1 | Adet |
| Macroeconomics:A europoen perspective witm myeconlab acsee card (9780270000000) | 2 | Adet |
| MakingCitizen-Soldiers: ROTC and the Ideology of American MilitaryService (978-0674007154) | 1 | Adet |
| Manifoldsand Differential Geometry (Graduate Studies in Mathematics) (978-0821848159 ) | 1 | Adet |
| Manualof Photogrammetry. Fifth Edition (-10: 1570830711 -13:978-1570830716) | 2 | Adet |
| ManufacturingIdeology: Scientific Management in Twentieth-Century Japan(978-0691074566) | 1 | Adet |
| MarineGeographical Information Systems: Theory and Applications Series:Advances in Geographic Information Science (978-3-540-85905-5) | 1 | Adet |
| MaterialisingExile (978-1845456405) | 1 | Adet |
| MathematicalMorphology in Geomorphology and GISci (9781439872000 ) | 1 | Adet |
| Mathematicsfor high school teachers: an advanced perspective (0130449415,9780130449412) | 1 | Adet |
| Max/MSP/Jitterfor Music: A Practical Guide to Developing Interactive MusicSystems for Education and More (0199777683 / 978-0199777686) | 1 | Adet |
| Mechanicsof Materials, SI Edition 7e (ISBN-13: 9780495438076 ISBN-10:0495438073 ) | 10 | Adet |
| Methodologyof Data Harmonisation and Integration in Spatial DataInfrastructures Series: Lecture Notes in Geoinformation andCartography (978-3-642-22035-7) | 1 | Adet |
| Microgridsand Active Distribution Networks | 2 | Adet |
| ModernDifferential Geometry of Curves and Surfaces with Mathematica,Third Edition (Studies in Advanced Mathematics) (978-1584884484 ) | 1 | Adet |
| MuseumStudies in Context (978-0631228301) | 1 | Adet |
| MuseumsAfter Modernism: Strategies of Engagement (New Interventions inArt History) (978-1405136280) | 1 | Adet |
| Museumsand Communities (978-1560981893) | 1 | Adet |
| Museumsand Families (978-1598740769) | 1 | Adet |
| Museumsand Source Communities (978-0415280525) | 1 | Adet |
| Museumsat Play: Games, Interaction and Learning | 1 | Adet |
| MuseumsMaterialities: Objects, Engagements, Interpretations (978-0415492188) | 1 | Adet |
| MuseumsPlace to Work - Planning Museum Careers (978-0415127240) | 1 | Adet |
| Museums,Objects and Collections | 1 | Adet |
| Museums,Society, Inequality (978-0415260602) | 1 | Adet |
| MusicNotation in the Twentieth Century: A Practical Guidebook(0393950530 / 978-0393950533) | 1 | Adet |
| Naiveand the Sentimental Novelist (Charles Eliot Norton Lectures) (:9780674050761) | 1 | Adet |
| Nanophotonics(978-0471649885) | 3 | Adet |
| Napoleon(978-1849164108) | 1 | Adet |
| Narrative,Apparatus, Ideology: A Film Theory Reader (ISBN-10: 0231058810) | 1 | Adet |
| NationalScience Education Standards (ISBN-10: 0-309-05326-9) | 2 | Adet |
| Nationalismfrom the Left: The Bulgarian Communist Party during the SecondWorld War and the Early Post-War Years (9789000000000) | 1 | Adet |
| Nationalistthought and the colonial world : a derivative discourse (978-0816623112) | 1 | Adet |
| NavigationalSystems and Simulators: Marine Navigation and Safety of SeaTransportation (9780415691130 ) | 1 | Adet |
| Neccesity,Proportionality and Use of Force by States | 1 | Adet |
| Nemesisof Power: The German Army in Politics 1918-1945 (978-1403918123) | 1 | Adet |
| NetworkGIS (978-3-540-36768-0) | 1 | Adet |
| NetworkQuality Control (978-9071301988) | 3 | Adet |
| NewMethods in Reading Comprehension Research (898593646) | 1 | Adet |
| NIST-JANAFThermochemical Tables (978-1-56396-831-0) | 1 | Adet |
| NoiseMapping in the EU: Models and Procedures (9780415585095) | 1 | Adet |
| Nonlinearand Hybrid Systems in Automotive Control (978-0-7680-1137-1) | 1 | Adet |
| NormativeTheory in International Theory (978-0521630504) | 1 | Adet |
| Noteson introductory combinatorics | 1 | Adet |
| Novel: An Alternative History : Beginnings to 1600 | 1 | Adet |
| ObservationalCinema: Anthropology, Film, and the Exploration of Social Life (ISBN-10:253221587) | 1 | Adet |
| OfficialMethods and Recommended Practices of the AOCS, 6th Edition, 2ndEdition (978-1-893997-74-5) | 1 | Adet |
| OltrafastOptics (978-0-471-41539-8) | 2 | Adet |
| OnSociety (978-0745648422) | 1 | Adet |
| OnlineMaps with APIs and Web Services Series: Lecture Notes inGeoinformation and Cartography (978-3-642-27484-8) | 1 | Adet |
| OperationsManagement (136119417) | 1 | Adet |
| OpposedPiston Engines (978-0-7680-1800-4) | 1 | Adet |
| OpticakProperties and Spectroscopy of Nanomaterials (978-981-283-664-9) | 1 | Adet |
| OpticalMetrology (0-470-84300-4) | 1 | Adet |
| OpticalMicroresonators (978-0-387-73067-7) | 1 | Adet |
| OpticalSpectroscopy: Methods and Instrumentations (978-0444521262) | 1 | Adet |
| Optics(978-0-12-370611-9) | 2 | Adet |
| OrganizationDevelopment (978-1-4129-8774-5) | 1 | Adet |
| OrganizationalBehavior (978-1-118-12931-9) | 1 | Adet |
| OrganizationalBehavior (978-0538478137 ) | 1 | Adet |
| OrganizationalCommunication (978-0495898320 ) | 1 | Adet |
| OrganizationalDevelopment and Change (0-324-58058-1) | 1 | Adet |
| OttomanUlema, Turkish Republic (978-0804773119) | 1 | Adet |
| OutputCoupling in Optical Cavities and Lasers (978-3-527-40763-7) | 1 | Adet |
| Palestineand the Arab-Israeli Conflict: A History with Documents(978-0312535018) | 2 | Adet |
| Panorama ( -10: 1861891237) | 1 | Adet |
| PatternRecognition and Machine Learning (Information Science andStatistics) (978-0387310732) | 1 | Adet |
| PatternRecognition in Medical Imaging (978-0124932906) | 1 | Adet |
| PavementManagement Guide, 1st Edition, Single User Digital Publication(1-56051-155-9) | 1 | Adet |
| Pearlsof Discrete Mathematics (Discrete Mathematics and ItsApplications) (978-1439816165 /// 1439816166) | 1 | Adet |
| Perry`sChemical Engineers` Handbook, Eighth Edition | 3 | Adet |
| Perspectiveson Intelligent Transportation Systems (ITS) (ISBN-10: 1441935908ISBN-13: 978-1441935908) | 1 | Adet |
| Perspectiveson Scientific Argumentation (ISBN 978-94-007-2469-3) | 1 | Adet |
| Philosophyin the Present (978-0745640976) | 1 | Adet |
| PhotographicMemory: The Album in the Age of Photography (ISBN-10:1597111317) | 1 | Adet |
| PhotographyAfter Conceptual Art (Art History Special Issues) (-10:1444333607) | 1 | Adet |
| PhotographyAfter Frank (ISBN-10:1597110957) | 1 | Adet |
| PhotographyDegree Zero: Reflections on Roland Barthes`s Camera Lucida(ISBN-10:262516667) | 1 | Adet |
| Photography:History and Theory (ISBN-10:415778557) | 1 | Adet |
| PhotonicMicroresonator Research and Applications (978-1-4419-1743-0) | 1 | Adet |
| Photonicsand Laser Engineering: Principles, Devices, and Applications (978-0071606080) | 3 | Adet |
| Photonicsand Lasers (978-0-471-71974-8) | 1 | Adet |
| Placesof the Imagination (978-1933253640) | 1 | Adet |
| Politicsin Russia (978-0205005796) | 1 | Adet |
| Politicsof Heritage (978-0415322119) | 1 | Adet |
| Politics,Archaeology and the Creation of a National Museum of Ireland (978-0716527299) | 1 | Adet |
| PortDesigners Handbook (-10: 0727740865 | -13: 978-0727740861 ) | 1 | Adet |
| PositiveOrganizational Behavior (978-1-4129-1212-9) | 1 | Adet |
| PositivePschology at Work | 1 | Adet |
| PostKeynesian Macroeconomic Theory | 1 | Adet |
| PosthegemonyPolitical Theory and Latin America (978-0-8166-4715-6 ) | 1 | Adet |
| Post-QuantumCryptography (978-3-540-88701-0) | 1 | Adet |
| Post-theory:Reconstructing Film Studies (Wisconsin Studies in Film) [ | 1 | Adet |
| Povertyand Neoliberalism: Persistence and Reproduction in the GlobalSouth (978-0745319605) | 1 | Adet |
| PowerSystem Dynamics: Stability & Control (1904798012,978-1904798019) | 1 | Adet |
| PowerSystems Dynamics (1906574847, 978-1906574840) | 1 | Adet |
| PRACTICALCRYTOGRAPHY (0471223573 /// 978-0471223573) | 1 | Adet |
| PracticalBiomedical Signal Analysis Using MATLAB® (Series in MedicalPhysics and Biomedical Engineering) | 1 | Adet |
| PracticalDiesel-Engine Combustion Analysis (978-0-7680-0914-9) | 1 | Adet |
| PracticalEvaluation Guide: Tools for Museums and Other Informal EducationSettings 2/E (978-0759113039) | 1 | Adet |
| PracticalLighting Design with LEDs (IEEE Press Series on Power Engineering)(978-0470612798) | 1 | Adet |
| PracticalLinear Algebra: A Geometry Toolbox ( 978-1568812342 ) | 1 | Adet |
| PracticalManagement Science (4th Edition) | 1 | Adet |
| PRINCIPLESAND APPLICATIONS OF TRIBOLOGY (0-471-59407-5) | 1 | Adet |
| Principlesand standards for school mathematics (0873534808, 9780873534802) | 1 | Adet |
| Principlesof GNSS, Inertial, and Multisensor Integrated Navigation Systems(GNSS Technology and Applications) (1580532551) | 1 | Adet |
| Principlesof Lasers materials Processing (978-0-470-17798-3) | 2 | Adet |
| Principlesof Vibration Analysis with Applications in Automotive Engineering(978-0-7680-3339-7) | 1 | Adet |
| Principlesof x-ray crystallography (ISBN-10: 0199569045) | 1 | Adet |
| Probability,stochastic processes, and queueing theory (ISBN-10: 1441928464 ISBN-13: 978-1441928467) | 1 | Adet |
| Problemsof Number Theory in Mathematical Competitions (//// 9789814271141) | 1 | Adet |
| ProgrammingGPS and OpenStreetMap Applications with Java: The RealObjectApplication Framework (9781466507180) | 1 | Adet |
| Progressin Geospatial Analysis (978-4-431-53999-5) | 1 | Adet |
| PropensityScore Analysis: Statistical Methods and applications(978-1-4129-5356-6) | 1 | Adet |
| PropulsionSystems for Hybrid Vehicles | 1 | Adet |
| Prospectsfor Democracy-North, South, East,West (978-0745609898) | 1 | Adet |
| ProteinEngineering Protocols | 1 | Adet |
| ProteinPurification Protocols, 2nd Edition | 1 | Adet |
| Protocolsand Architectures for Wireless Sensor Networks(978-0470519233) | 1 | Adet |
| Pseudo-ReimannianGeometry, D-Invariants and Applications [Hardcover] (978-9814329637 ) | 1 | Adet |
| QuantumComputation and Quantum Information (978-1107002173 ) | 2 | Adet |
| QuantumComputation, Quantum Error Correcting Codes and Information Theory(978-81-7319-688-1 ) | 1 | Adet |
| QuantumCryptography and Secret-Key Distillation (978 0 521 86485 5 ) | 1 | Adet |
| QuantumInformation (978-3-540-30265-0) | 1 | Adet |
| QuantumInformation, Computation and Cryptography: An Introductory Surveyof Theory, Technology and Experiments (978-3642119132 ) | 2 | Adet |
| QuantumInformation: An Overview ( 978-1441922588 ) | 1 | Adet |
| Quantuminformation science and its contributions to mathematics : AMSShort Course, quantum computation and quantum information, January3-4, 2009, W (978 0 821 84828 9 0821848283) | 1 | Adet |
| RailroadEconomics (0-7623-1255-6) | 1 | Adet |
| RailwayLegislation Handbook - completely revised and extended secondedition (978-3-7771-0389-1) | 1 | Adet |
| RaisingYour Spirited Child Workbook (978-0060952402) | 2 | Adet |
| Ramanujan:essays and surveys (0-8218-2624-7) | 1 | Adet |
| Re/StructuringScience Education (ISBN 978-90-481-3995-8) | 1 | Adet |
| ReadingPoulantzas (978-0-85036-647-1) | 1 | Adet |
| Recenttrends in coding theory and its applications (978 0 821 84298 00821842986) | 1 | Adet |
| Reflexivityin Film and Literature | 1 | Adet |
| ReformingRailways (978-3-7771-0415-7) | 1 | Adet |
| ReframingPhotography: Theory and Practice (ISBN-10:415779197) | 1 | Adet |
| Refugeeaid and development : theory and practice | 1 | Adet |
| Regionsand Powers: The Structure of International Security(978-0521891110) | 1 | Adet |
| ReimaginingCulture (978-1859739853) | 1 | Adet |
| ReinventingInteractive and Direct Marketing: Leading Experts Show How toMaximize Digital ROI with iDirect and iBranding Imperatives, 1stEdition | 1 | Adet |
| Remappingthe Ottoman Middle East: Modernity, Imperial Bureaucracy and theIslamic State (978-1848859586) | 2 | Adet |
| RemarkableMathematicians (From Euler to Von Neuman) (0 521 81777 3 ///// 0 521 52094 0) | 1 | Adet |
| RemoteSensing and Global Environmental Change (ISBN: 978-1-4443-3935-2) | 2 | Adet |
| RemoteSensing of the Environment: An Earth Resource Perspective, 2/E(ISBN-10: 0131889508 ISBN-13: 9780131889507) | 2 | Adet |
| RemoteSensing: Principles and Interpretation(3.edition) (ISBN-10:1577665074 ISBN-13: 978-1577665076) | 1 | Adet |
| Representation(978-0761954323) | 1 | Adet |
| RepresentingCapital: A Reading of Volume One (978-1844674541) | 1 | Adet |
| RepresentingReality: Issues and Concepts in Documentary (ISBN-10: 0253206812) | 1 | Adet |
| Representingthe Nation (978-0415208703) | 1 | Adet |
| ReputationManagement (978-0415801843) | 1 | Adet |
| Researchdesign: Qualitative, quantitative, and mixed methods approaches(978-1412965576) | 1 | Adet |
| ResearchMethods in e-Learning Systems. Perspectives on Design,Development, Assessment and Analysis (978-1441995797) | 1 | Adet |
| ResearchMethods: The Key Concepts (ISBN-10:0415599830) | 1 | Adet |
| Resistancesof Psychoanalysis (978-0804730198) | 1 | Adet |
| RetailManagement: A Strategic Approach, 11/E (978-0136087588) | 1 | Adet |
| Revolutionand Constitutionalism in the Ottoman Empire and Iran(978-0521198295) | 1 | Adet |
| Revolutionand State in Modern Mexico: The Political Economy of UnevenDevelopment (978-0742554894) | 1 | Adet |
| RevolutionaryIran and The United States Low Intensity Conflict in the PersianGulf (9780754676706) | 1 | Adet |
| RiemannianGeometry (Universitext) (978-3540204930 ) | 1 | Adet |
| RiemannianGeometry [Hardcover] ( 978-0817634902 ) | 1 | Adet |
| RiemannianGeometry During the Second Half of the Twentieth Century(University Lecture Series) (978-0821820520 ) | 1 | Adet |
| RoadVehicle Dynamics: Fundamentals and Modeling (9781439838983) | 1 | Adet |
| RobotModeling and Control (978-0471649908 ) | 1 | Adet |
| Robotics,Vision and Control: Fundamental Algorithms in MATLAB(978-3642201431) | 1 | Adet |
| RobustControl of Robots (978-0-85729-897-3) | 1 | Adet |
| Roleof the Seat in Rear Crash Safety (978-0-7680-0847-0) | 1 | Adet |
| RuralPeople and Communities in the 21st Century (978-0745641287) | 1 | Adet |
| RussianGovernment and Politics (Comparative Government and Politics) (978-0230235861) | 1 | Adet |
| Safetyand Security in Railway Engineering (1845644964) | 1 | Adet |
| SafetyCritical Systems Handbook: A STRAIGHTFOWARD GUIDE TO FUNCTIONALSAFETY, IEC 61508 (2010 EDITION) AND RELATED STANDARDS, INCLUDINGPROCESS IEC 6 | 1 | Adet |
| SafetyInstrumented Systems: Design, Analysis, and Justification(047097981X) | 1 | Adet |
| Satellitenortungund Navigation: Grundlagen, Wirkungsweise und Anwendung globalerSatellitennavigationssysteme (9783834806116) | 1 | Adet |
| Schaum`sOutline of Discrete Mathematics, Revised Third Edition (Schaum`sOutline Series) (978-0071615860 /// 0071615865) | 1 | Adet |
| ScienceEducation in a Rapidly Changing World (Education in a Competitiveand Globalizing World) (978-1617289149) | 2 | Adet |
| ScienceFormative Assessment (978-1-4129-4179-2) | 1 | Adet |
| Sciencein Elementary Education: Methods, Concepts, and Inquiries (978-0131381391) | 1 | Adet |
| Sciencesof Geodesy - I: Advances and Future Directions (978-3642117404) | 3 | Adet |
| ScientificInquiry and Nature of Science: Implications for Teaching,Learning,and Teacher Education (Contemporary Trends and Issues in ScienceEducati (978-1402051500) | 2 | Adet |
| SelectedUnsolved Problems in Coding Theory (978-0-8176-8255-2) | 1 | Adet |
| SelfDual Codes and Invariant Theory | 1 | Adet |
| SemiconductorDisk Lasers (978-3-527-40933-4) | 1 | Adet |
| ServicesMarketing, 7/E (978-0136107217) | 1 | Adet |
| SetLinear Algebra and Set Fuzzy Linear Algebra (1-59973-029-4) | 1 | Adet |
| Shakespeare`sTwenty-First Century Economics: The Morality of Love and Money(978-0195128611) | 1 | Adet |
| SimpleModels of Magnetism (978–0–19–857075–2) | 1 | Adet |
| Simulationof Complex Systems in GIS (9781848212237) | 1 | Adet |
| Simulationwith Arena (978-0071267717) | 3 | Adet |
| Sixpillars of self-esteem (978-0553374391) | 1 | Adet |
| SMARANDACHEFUZZY ALGEBRA (1-931233-74-8) | 1 | Adet |
| SmartGrid: Fundamentals of Design and Analysis (978-0470889398 ) | 2 | Adet |
| SmartGrid: Integrating Renewable, Distributed & Efficient Energy(978-0123864529 ) | 2 | Adet |
| SmartGrid: Technology and Applications (978-0470974094 ) | 2 | Adet |
| SocialDesign in Museums: The Psychology of Visitor Studies Volume Two | 1 | Adet |
| SocialEngineering: The Art of Human Hacking | 1 | Adet |
| SocialJustice and Neoliberalism (978-1842779200) | 1 | Adet |
| SocialMedia Analytics: Effective Tools for Building, Interpreting, andUsing Metrics, 1st Edition | 1 | Adet |
| SocialMedia Marketing: Strategies for Engaging in Facebook, Twitter &Other Social Media | 1 | Adet |
| socialmovements, mobilization, and contestation in the Middle East andNorth Africa | 1 | Adet |
| SocialPsychology (0-8400-3217) | 1 | Adet |
| Sociology(978-0745643588) | 1 | Adet |
| SociologyIntroductory Readings (978-0745648842) | 1 | Adet |
| Sociology-Ashort introduction (978-0745625423) | 1 | Adet |
| Soldiers,Citizens and Civilian (978-0230545342) | 1 | Adet |
| SolidWorks2011 Tutorial | 1 | Adet |
| Songsof a Wayfarer and Kindertotenlieder in Full Score (0-486-26318-5) | 2 | Adet |
| SpaceTime Coding (0-470-84757-3) | 1 | Adet |
| SpatialAnalysis and Modeling in Geographical Transformation Process:GIS-based Applications Series: GeoJournal Library, Vol. 100(978-94-007-0670-5) | 1 | Adet |
| Spatialand Spatiotemporal Data Mining (9781439814185 ) | 1 | Adet |
| SpatialData Management (978-1608458325) | 1 | Adet |
| SpectrometricIdentification of Organic Compounds (ISBN-10: 0471393622) | 1 | Adet |
| SpectroscopicProperties of Rare Earths in Optical Materials (3-540-23886-7 ) | 1 | Adet |
| SportFans: The Psychology and Social Impact of Spectators | 1 | Adet |
| SportsMarketing: A Strategic Perspective, 4/E | 1 | Adet |
| SpreadsheetModeling and Applications: Essentials of Practical ManagementScience | 1 | Adet |
| SpringerHandbook of Geographic Information (978-3-540-72678-4) | 1 | Adet |
| Stagingthe People: The Proletarian and His Double (978-1844676972) | 1 | Adet |
| StatisticalOptics (0-47 1-3991 6-7) | 1 | Adet |
| StatisticalOrbit Determination (978-0126836301) | 3 | Adet |
| StatisticalPattern Recognition (978-0122698514) | 1 | Adet |
| Stepsto an Ecology of Mind: Collected Essays in Anthropology,Psychiatry, Evolution, and Epistemology (ISBN-10:226039056) | 1 | Adet |
| Stocktakingsfrom an Apprenticeship (0193112108 / 978-0193112100) | 1 | Adet |
| StoryBridges: A guide for conducting intergenerational oral historyprojects | 1 | Adet |
| StorytellerGuitar | 1 | Adet |
| StrategicMarketing (978-0136028048) | 1 | Adet |
| Structureof Materials (978-0-521-65151-6) | 1 | Adet |
| SuccessfulScientific Writing.2nded. ((ISBN-10:0521699274|ISBN-13:978-0521699273)) | 2 | Adet |
| Sustainabilityof construction materials (Son Baskı/978-1439801307) | 1 | Adet |
| SYMPHONIESNos. 1 and 2 In Full Score (0-486-25473-9 (pbk)) | 2 | Adet |
| SYMPHONIESNOS. 3 AND 4 In Full Score (0-486-26166-2) | 2 | Adet |
| SYMPHONIESNOS. 5 & 6 In Full Score (0-486-26888-8) | 2 | Adet |
| SYMPHONYNO. 7 In Full Score (0-486-27339-3) | 2 | Adet |
| SymphonyNo. 8 In Full Score (0-486-26022-4) | 2 | Adet |
| SYMPHONYNo. 9 In Full Score (0-486-27492-6 (pbk)) | 2 | Adet |
| Synchronizationand Control of Multiagent Systems (978-1-43-982047-6) | 1 | Adet |
| Talesof Crossed Destinies : Modern Turkish Novel in a ComparativeContext (9781600000000) | 1 | Adet |
| Tamingthe Spirited Child | 2 | Adet |
| Teachingin the Art Museum: Interpretation as Experience | 1 | Adet |
| Teachingstudent-centered mathematics (0205408435, 9780205408436) | 1 | Adet |
| TeachingVisual Literacy in the Primary Classroom: Comic Books, Film,Television and Picture Narratives (13:978-0415-48984-3(hbk)) | 1 | Adet |
| Teaching&LearningThrough Multiple Intelligences | 1 | Adet |
| TechnicalCalculus with Analytic Geometry (Dover Books on Mathematics) (978-0486673431 ) | 1 | Adet |
| TheActuality of Communism (978-1844676958) | 1 | Adet |
| TheArchitecture of the Museum (978-0719056109) | 1 | Adet |
| TheArt of Life (978-0745643267) | 1 | Adet |
| TheArt of the Portrait (Masterpieces of European Portrait Painting,1420-1670) (-10:3822819956) | 1 | Adet |
| TheAutomotive Chassis: Components design (9781400000000) | 1 | Adet |
| TheBasic Design of Two-Stroke Engines (1-56091-008-9) | 1 | Adet |
| TheBerlin-Baghdad Express: The Ottoman Empire and Germany`s Bid forWorld Power (978-0674057395) | 1 | Adet |
| TheBiodiesel Handbook (ISBN: 978-1-893997-79-0) | 1 | Adet |
| TheBlitzkrieg Era and the German General Staff (978-0813507040) | 1 | Adet |
| TheBritish Industrial Revolution in Global Perspective(978-0521868273) | 1 | Adet |
| TheCambridge History of Medicine (978-0521864268) | 1 | Adet |
| TheCambridge Companion to Heidegger (978-0521528887) | 1 | Adet |
| TheCambridge companion to Lacan (052-1807441) | 1 | Adet |
| TheCambridge History of Turkey, Volume 1: Byzantium to Turkey,1071-1453 (978-0521620932) | 1 | Adet |
| TheCambridge Illustated History of China (978-0521196208) | 1 | Adet |
| TheCambridge Illustated History of Religions (978-0521810371) | 1 | Adet |
| TheCambridge Illustrated History of the British Empire (978-0521002547) | 1 | Adet |
| TheCambridge Illustrated History of the Islamic World(978-0521669931) | 1 | Adet |
| TheCamera as Historian: Amateur Photographers and HistoricalImagination, 1885–1918 (Objects/Histories) (ISBN-10:822351048) | 1 | Adet |
| TheChallenge of Financial Stability | 1 | Adet |
| TheComing of the Book: The Impact of Printing, 1450-1800(978-1844676347) | 1 | Adet |
| Theconcept of identity | 1 | Adet |
| Theconcept of validity. Revisions, new directions,and applications(978-1-60752-228-7) | 1 | Adet |
| TheConduct of War (978-1113665966) | 1 | Adet |
| TheContemporary Middle East: A Westview Reader (978-0813344652) | 2 | Adet |
| TheConvivial Museum (978-1933253622) | 1 | Adet |
| TheCorporate Culture (978-0-470-29371-3) | 1 | Adet |
| TheCrimean War: A History (978-0805074604) | 1 | Adet |
| TheCultural Front: The Laboring of American Culture in the TwentiethCentury | 1 | Adet |
| TheCultural Leadership Handbook: How to Run a Creative Organization | 1 | Adet |
| TheDevelopment Dictionary (978-1848133808) | 1 | Adet |
| TheEffective Teaching of Biology (Effective Teacher Series) (ISBN-10: 0582095050 | ISBN-13: 978-0582095052) | 1 | Adet |
| TheEinstein Theory of Relativity ( 978-1557427120 ) | 1 | Adet |
| TheElm and The Expert: Mentalese and its Semantics | 1 | Adet |
| Theend of Certainty: Toward a New Internationalism (978-1848133044) | 1 | Adet |
| TheEvolution of International Security Studies (978-0521694223) | 1 | Adet |
| TheField Trip Book: Study Travel Experiences in Social Studies | 1 | Adet |
| TheFinancial Crisis and the Regulation of Finance | 1 | Adet |
| TheFirst Panoramas: Visions of British Imperialism (ISBN 10:816648611) | 1 | Adet |
| TheFirst Total War: Napoleon`s Europe and the Birth of Warfare as WeKnow It (978-0618349654) | 1 | Adet |
| TheForeign Office Mind: The Making of British Foreign Policy,1865-1914 [Hardcover] (978-1107006508) | 1 | Adet |
| TheFranco-Prussian War: The German Invasion of France 1870-1871 (978-0415266710) | 1 | Adet |
| TheFrench Defence Debate (978-0312231545) | 1 | Adet |
| TheGeometry of Spacetime ( 978-0387986418 ) | 1 | Adet |
| TheGuns of August (978-0345476098) | 1 | Adet |
| TheHabermas Reader (978-0745613949) | 1 | Adet |
| TheHabsburg Monarchy, 1618-1815 (978-0521785051) | 1 | Adet |
| TheHistory Of Militarism: Romance And Realities Of A Profession (978-1258046774) | 1 | Adet |
| TheHour of Europe: Western Powers and the Breakup of Yugoslavia | 1 | Adet |
| TheIndustrial Revolution in World History (978-0813343600) | 1 | Adet |
| TheInternal Combustion Engine in Theory and Practice: Vol. 1 - 2ndEdition, Revised (978-0-262-70026-9) | 1 | Adet |
| TheInternal Combustion Engine in Theory and Practice: Vol. 2 - 2ndEdition, Revised (978-0-262-70027-6) | 1 | Adet |
| TheInternational Political Economy of Transition: Neoliberal Hegemonyand Eastern Central Europe`s Transformation (978-0415386692) | 1 | Adet |
| Theidentity in question | 1 | Adet |
| TheJapanese Colonial Empire, 1895-1945 (978-0691102221) | 1 | Adet |
| TheJapanese Wartime Empire, 1931-45 (978-0691145068) | 1 | Adet |
| TheKaiser: New Research on Wilhelm II`s Role in Imperial Germany (978-0521179805) | 1 | Adet |
| TheLast Ottomans: The Muslim Minority of Greece 1940-1949(978-0230232518) | 1 | Adet |
| TheLongman Guide to Peer Tutoring ((ISBN-10:0205573320|ISBN-13:978-0205573325)) | 2 | Adet |
| TheLost Literature of Socialism (978-0718892272) | 1 | Adet |
| Themaking of terrorism | 1 | Adet |
| TheMan Without a Face: The Unlikely Rise of Vladimir Putin(978-1594488429) | 1 | Adet |
| TheMargins of Empire: Kurdish Militias in the Ottoman Tribal Zone(978-0804775700) | 1 | Adet |
| TheMarx Reader (978-0745617282) | 1 | Adet |
| TheMathematics of combustion | 1 | Adet |
| TheMathematics of Minkowski Space-Time: With an Introduction toCommutative Hypercomplex Numbers (Frontiers in Mathematics) (978-3764386139 ) | 1 | Adet |
| TheMobile Marketing Revolution: How Your Brand Can Have a One-to-OneConversation with Everyone, 1st Edition | 1 | Adet |
| TheMonumental Inscriptions From Early Islamic Iran and Transoxiana(978-9004093676) | 1 | Adet |
| TheMorality of War (978-1551117270) | 1 | Adet |
| TheMuseum in Transition (978-1560983965) | 1 | Adet |
| TheMuseum Transformed (978-1558590649) | 1 | Adet |
| TheNation in Arms (978-1112537516) | 1 | Adet |
| TheNew Development Management (978-1842779224) | 1 | Adet |
| TheNew Museology (978-0948462030) | 1 | Adet |
| TheNew Old World | 1 | Adet |
| TheNew Science of Metagenomics: Revealing the Secrets of OurMicrobial Planet | 1 | Adet |
| TheNineteenth Century: Europe, 1789-194 (978-0198731351) | 1 | Adet |
| TheOrigins of American Photography: From Daguerreotype to Dry-Plate,1839-1885: The Hallmark Photographic Collection at TheNelson-Atkins Museum of A (ISBN-10:300122861) | 1 | Adet |
| TheOttoman Crimean War, 1853-56 (978-9004182059) | 1 | Adet |
| TheOxford Handbook of International Relations (019958558X) | 2 | Adet |
| TheOxford Handbook of Positive Organizational Scholarship(978-0-19-973461) | 1 | Adet |
| TheOxford History of Islam (978-0195107999) | 1 | Adet |
| ThePanorama: History of a Mass Medium (ISBN-10: 942299833) | 1 | Adet |
| TheParticipation Reader (978-1842774038) | 1 | Adet |
| ThePassenger Car Body (978-0-7680-0708-4) | 1 | Adet |
| ThePhysics of Phonons (978-0852741535) | 1 | Adet |
| ThePiaget primer: thinking, learning, teaching | 1 | Adet |
| Thepolitical mobilization of the European left, 1860-1980 : the classcleavage | 1 | Adet |
| ThePolitical Philosophy: The Essential Texts | 2 | Adet |
| ThePolitics of Conversion and Apostasy in the Late Ottoman Empire (978-1107004559) | 1 | Adet |
| ThePolitics of Display (978-0415153263) | 1 | Adet |
| ThePrecariat: The New Dangerous Class | 1 | Adet |
| Thepsychology of mathematics for instruction (0898590299,9780898590296) | 1 | Adet |
| ThePublic Art Museum in Nineteenth Century Britain (978-0754632368) | 1 | Adet |
| TheResurrection and Collapse of Empire in Habsburg Serbia(978-0521896276) | 1 | Adet |
| TheReturn: Russia`s Journey from Gorbachev to Medvedev | 1 | Adet |
| Therights of others : aliens, residents, and citizens (521-831342) | 1 | Adet |
| TheRise and Fall of the Welfare State | 1 | Adet |
| TheSAGE Handbook of Action Research: Participative Inquiry andPractice (978-1412920292) | 2 | Adet |
| TheSAGE Handbook of Qualitative Research (978-1412974172) | 2 | Adet |
| TheSamurai: A Military History (978-1873410387) | 1 | Adet |
| TheSecond World War: A Complete History (978-0805076233) | 1 | Adet |
| TheSecond World War: An Illustrated History (978-0241892053) | 1 | Adet |
| Thesettlement issue in Turkey and the Kurds : an analysis of spatialpolicies, modernity and war | 1 | Adet |
| TheShows of London (ISBN-10: 0674807316) | 1 | Adet |
| TheSmart Grid:Enabling Energy Efficiency and Demand Response(978-1439815748 ) | 2 | Adet |
| TheSociology of Islam: Secularism, Economy and Politics(978-0-86372-371-1) | 1 | Adet |
| TheSoldier and the State (978-0674817364) | 1 | Adet |
| TheStory of Film (ISBN-10: 186205942X) | 1 | Adet |
| Thestory of notation (ASIN B004SYLDB4) | 1 | Adet |
| Thestudy of orchestration (039397572X / 978-0393975727) | 1 | Adet |
| TheTailor of Ulm: A History of Communism | 1 | Adet |
| TheTexture of Memory (978-0300059915) | 1 | Adet |
| Thetheory and practice of item response theory (978-1-59385-869-8) | 1 | Adet |
| Thetheory of Information and Coding (0 521 00095 5) | 1 | Adet |
| TheTransformation of Turkey: Redefining State and Society from theOttoman Empire to the Modern Era (978-1848856110 ) | 1 | Adet |
| TheUnited Nations, peace and Security: from Collective security toResponsbility to protect | 1 | Adet |
| TheUS Army/Marine Corps Counterinsurgency Field Manual(978-0226841519) | 1 | Adet |
| Thevan Hiele model of the development of geometric thought. (087353235X, 9780873532358) | 1 | Adet |
| TheVirtopsy Approach: 3D Optical and Radiological Scanning andReconstruction in Forensic Medicine (978-0849381782) | 1 | Adet |
| TheWar for Palestine: Rewriting the History of 1948 (978-0521699341) | 1 | Adet |
| TheYoung Turk Legacy and Nation-Building (978-1848852716) | 1 | Adet |
| Theatresof Memory (v. 1) (978-1859840771) | 1 | Adet |
| TheorizingMuseums (978-0631201519) | 1 | Adet |
| Theoryin an Uneven World (978-0631175384) | 1 | Adet |
| Theoryof engine manifold design: wave action methods for IC engines | 1 | Adet |
| Theoryof Machines and Mechanisms ( 978-0195371239 ) | 1 | Adet |
| Theoryof Quantum Computation, Communication and Cryptography(978-3-642-18072-9) | 1 | Adet |
| ThermodynamicProperties of Solids: Experiment and Modeling (978-3-527-40812-2) | 1 | Adet |
| Thisis not a Diary (978-0745655703) | 1 | Adet |
| Tirpitzand the Imperial German Navy (978-0253355935) | 1 | Adet |
| ToEnd All Wars: A Story of Loyalty and Rebellion, 1914-1918(978-0618758289) | 1 | Adet |
| TowardMore Sustainable Infrastructure: Project Evaluation for Plannersand Engineers (978-0-470-44876-2) | 1 | Adet |
| Towardsa New Manifesto (978-1844678198) | 1 | Adet |
| TowardsLearning and Instruction in Web 3.0:Advances in Cognitive andEducational Psychology (978-1461415381) | 1 | Adet |
| TransFats in Food (978-1-893997-96-7) | 1 | Adet |
| TransformingMuseums in the 21st Century (978-0415615730) | 1 | Adet |
| Transparencyand American Primacy in World Politics (-13: 978-0754671862 ) | 1 | Adet |
| TransportationLand Use, Planning, and Air Quality (-10: 0784409609 -13:978-0784409602) | 1 | Adet |
| TroubleshootingMarine Diesel Engines, 4th Ed (0070123543 / 9780070123540) | 1 | Adet |
| TurboCodes: Principles and Applications | 1 | Adet |
| Turkeyin the 21st Century: Quest foe New Foreign Policy (978-1-4094-3184-8) | 7 | Adet |
| TurkeyUnveiled: A history of modern Turkey (978-1590206904) | 1 | Adet |
| TutoringWriting. ((-10:0867095180| -13:978-0867095180)) | 2 | Adet |
| Twentieth-CenturyWorld (978-0547218502 ) | 1 | Adet |
| Twilightat Conner Prairie: The Creation, Betrayal, and Rescue of a Museum(American Association for State and Local History) | 1 | Adet |
| TwoDimensional Information Theory and Coding (978-0-521-88860-8) | 1 | Adet |
| UltrasonicWaves in Solid Media (ISBN-10: 0521548896 / ISBN-13:978-0521548892) | 1 | Adet |
| UndergraduateAlgebra (Undergraduate Texts in Mathematics) (978-1441919595) | 1 | Adet |
| UnderstandingCryptography: A Textbook for Students and Practitioners(3642041000 /// 978-3642041006) | 1 | Adet |
| UnderstandingDigital Marketing: Marketing Strategies for Engaging the DigitalGeneration | 1 | Adet |
| UnderstandingFACTS: Concepts and Technology of FlexibleAC Transmission Systems(0-7803-3455-8) | 2 | Adet |
| UnderstandingHeritage & Memory (978-0719081538) | 1 | Adet |
| UnderstandingInequalities, Stratification and Difference (978-0745641768) | 1 | Adet |
| UnderstandingOrganizations (978-0745644288) | 1 | Adet |
| UnderstandingRussian Politics (978-0521688611) | 1 | Adet |
| UnevenEconomic Development (978-1848131958) | 1 | Adet |
| UnthinkingEurocentrism: Multiculturalism and the Media (ISBN-10: 0415063256) | 1 | Adet |
| Urbanand Regional Data Management: UDMS Annual 2011 (9780415674911 ) | 1 | Adet |
| UrbanNotables and Arab Nationalism (978-0521533232) | 1 | Adet |
| USForeign Policy (978-0-19-958581-6 ) | 2 | Adet |
| UsingMuseums as an Educational Resource: An Introductory Handbook forStudents and Teachers (Second Edition) (978-1933253646) | 1 | Adet |
| ValuingHistoric Environments (978-0754674245) | 1 | Adet |
| VanishedKingdoms (978-0670022731) | 1 | Adet |
| VBAfor Modelers: Developing Decision Support Systems, 4th Edition | 1 | Adet |
| VECTORMECHANICS for ENGINEERS, Statics and Dynamics (In SI Units), 9e (-10: 0077275551 -13: 978-0077275556) | 5 | Adet |
| VehicleAccident Analysis and Reconstruction Methods, Second Edition(978-0-7680-3437-0) | 1 | Adet |
| VehicleDynamics: Modeling and Simulation (978-3540360445) | 1 | Adet |
| VehicleNoise, Vibration, and Sound Quality ( 978-0-7680-3484-4) | 1 | Adet |
| VehiclePowertrain Systems: Integration and Optimization (978-0470666029) | 1 | Adet |
| Vehiclepropulsion systems: introduction to modeling and optimization | 1 | Adet |
| VerschiedeneKammermusikwerke by Johann Sebastian Bach (9790010000000) | 1 | Adet |
| VibrationControl of Active Structures (978-94-007-2032-9) | 1 | Adet |
| Victorythrough Coalition: Britain and France during the First World War(978-0521096294) | 1 | Adet |
| Violence:A New Approach | 1 | Adet |
| VirtualAnthropology: A guide to a new interdisciplinary field ( ISBN-10: 321148647X) | 1 | Adet |
| VirtualGeographic Environments (9781589483187) | 1 | Adet |
| Visualization:Theory and Practice in Science Education (Models and Modeling inScience Education) (978-1-4020-5266-8) | 1 | Adet |
| Warand the Cultural Turn (978-0745648347) | 1 | Adet |
| Warin an Age of Revolution, 1775-1815 (978-0521899963) | 1 | Adet |
| Warin Human Civilization (978-0199236633) | 1 | Adet |
| Warin the East: A Military History of the Russo-Turkish War, 1877-78(978-1907677113) | 1 | Adet |
| Warin the Nineteenth Century: 1800-1914 (978-0745644486) | 1 | Adet |
| Warmade new: weapons, warriors and the making of the modern world | 1 | Adet |
| WarMemories: The Revolutionary and Napoleonic Wars in Modern EuropeanCulture (War Culture Society 1750-1850) (978-0230272163) | 1 | Adet |
| Warof the Flea (978-1574885552) | 1 | Adet |
| WastedLives-Modernity and Its Outcasts (978-0745631653) | 1 | Adet |
| WhatGreat Paintings Say, Vol. 2 (ISBN-10:3822813729) | 1 | Adet |
| Whatis Cultural History (978-0745644103) | 1 | Adet |
| Whatis Environmental History (978-0745631899) | 1 | Adet |
| Whatis Global History (978-0745633015) | 1 | Adet |
| Whatis Military History (978-0745633916) | 1 | Adet |
| Whatis Social Policy? (978-0745645841) | 1 | Adet |
| WhereHave All the Soldiers Gone?: The Transformation of Modern Europe (978-0547086330) | 1 | Adet |
| WIRELESSCOMMUNICATION SYSTEMS ( 0-470-39983-X) | 1 | Adet |
| WildBill Donovan: The Spymaster Who Created the OSS and ModernAmerican Espionage (978-1416567448) | 1 | Adet |
| Workbookfor the study of orchestration (0393977005 / 978-0393977004) | 1 | Adet |
| WorldPolitics: Trend and Transformation (978-1111830069) | 2 | Adet |
| WritingOutside the Nation | 1 | Adet |
Temel
- EKAP İhaleleri
- Kurum İhaleleri
- Doğrudan Teminler
- İhale Alarmı - Sınırsız
- İhale Takip - Sınırsız
- Çoklu Rapor Alıcısı
- Mobil Uygulama
Kurumsal
- EKAP İhaleleri
- Kurum İhaleleri
- Doğrudan Teminler
- İhale Alarmı - Sınırsız
- İhale Takip - Sınırsız
- Çoklu Rapor Alıcısı
- Mobil Uygulama
- +
- İhale Sonuç İlanları
- İlansız İhale Sonuçları
- Sonuç Alarmları
- KİK Kararları
- Firma ve Rakip Analizleri
- Müşteriler, İş Bitirme Bilgileri, Kırım Oranları
- İhale Öncesi Olası Rakipler
- İdare Analizleri
- Bütçe Tahminleri
- Yüklenicileri
- Yaklaşık Maliyet Analizleri
- Sektör Analizleri
- Sektördeki Öncü Firmalar
- İş Dağılımları
- Pazar Araştırmaları
- Üst Yüklenici ve Alt Yüklenici Araştırması
- Rakip/Firma – İdare – Sektör Özel Takibi
- Haftalık İstihbarat Raporu (PDF)